The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-Phenylpropoxy)-9-(3-phenylpropyl)-2-benzyl-1-methyl-beta-carbolinium bromide ID: ALA2314903
PubChem CID: 71575487
Max Phase: Preclinical
Molecular Formula: C37H37BrN2O
Molecular Weight: 525.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(cc[n+]1Cc1ccccc1)c1ccc(OCCCc3ccccc3)cc1n2CCCc1ccccc1.[Br-]
Standard InChI: InChI=1S/C37H37N2O.BrH/c1-29-37-35(23-25-38(29)28-32-17-9-4-10-18-32)34-22-21-33(40-26-12-20-31-15-7-3-8-16-31)27-36(34)39(37)24-11-19-30-13-5-2-6-14-30;/h2-10,13-18,21-23,25,27H,11-12,19-20,24,26,28H2,1H3;1H/q+1;/p-1
Standard InChI Key: HGLGAJPVMSZZFE-UHFFFAOYSA-M
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
12.4050 -26.6433 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
12.5658 -28.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9034 -28.1265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4145 -27.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5963 -27.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2628 -28.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4740 -28.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7622 -28.1408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0463 -28.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0463 -29.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7622 -29.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4740 -29.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2628 -29.6347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7435 -28.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0505 -29.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6617 -30.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3304 -29.7909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6187 -29.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7279 -28.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1572 -28.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7577 -29.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1862 -30.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0119 -30.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4072 -29.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9763 -28.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2359 -31.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4111 -31.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6201 -28.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9062 -28.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1910 -28.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4800 -28.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7653 -28.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7635 -29.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4823 -29.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1941 -29.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9853 -31.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1619 -31.7349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7362 -32.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1354 -33.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9646 -33.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3865 -32.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
12 13 1 0
13 14 1 0
6 14 2 0
2 14 1 0
2 15 1 0
13 16 1 0
17 18 1 0
10 17 1 0
3 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 0
26 27 1 0
18 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
27 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.72Molecular Weight (Monoisotopic): 525.2900AlogP: 8.08#Rotatable Bonds: 11Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.30CX LogD: 4.30Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.12Np Likeness Score: -0.19
References 1. Cao R, Fan W, Guo L, Ma Q, Zhang G, Li J, Chen X, Ren Z, Qiu L.. (2013) Synthesis and structure-activity relationships of harmine derivatives as potential antitumor agents., 60 [PMID:23291116 ] [10.1016/j.ejmech.2012.11.045 ]