The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-(2-(Trifluoromethyl)benzoyl)piperazin-1-yl)-N-((5-(trifluoromethyl)furan-2-yl)methyl)-pyridazine-3-carboxamide ID: ALA2315116
PubChem CID: 71521266
Max Phase: Preclinical
Molecular Formula: C23H19F6N5O3
Molecular Weight: 527.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc(C(F)(F)F)o1)c1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1
Standard InChI: InChI=1S/C23H19F6N5O3/c24-22(25,26)16-4-2-1-3-15(16)21(36)34-11-9-33(10-12-34)19-8-6-17(31-32-19)20(35)30-13-14-5-7-18(37-14)23(27,28)29/h1-8H,9-13H2,(H,30,35)
Standard InChI Key: DKACSJZPBDPRDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
2.8294 -15.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6508 -15.1927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0599 -14.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8812 -14.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6519 -13.7690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2909 -15.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1114 -15.1936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5214 -14.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1090 -13.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2898 -13.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3431 -14.4826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7550 -15.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5727 -15.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9848 -14.4873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5770 -13.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7531 -13.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8061 -14.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2165 -15.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2211 -13.7794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7984 -15.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2082 -16.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0304 -16.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4411 -15.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0331 -15.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4405 -14.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2618 -14.4867 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0306 -13.7770 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8451 -13.7726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.3400 -14.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5797 -13.7556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9110 -13.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2568 -13.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5235 -14.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8986 -12.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -12.0479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1847 -12.0694 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.8944 -11.6470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 4 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
8 11 1 0
14 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 18 1 0
24 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
1 29 1 0
30 31 1 0
29 30 1 0
31 32 2 0
32 33 1 0
33 29 2 0
31 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.43Molecular Weight (Monoisotopic): 527.1392AlogP: 4.00#Rotatable Bonds: 5Polar Surface Area: 91.57Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.56CX Basic pKa: 1.61CX LogP: 3.33CX LogD: 3.33Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: -1.84
References 1. Zhang Z, Sun S, Kodumuru V, Hou D, Liu S, Chakka N, Sviridov S, Chowdhury S, McLaren DG, Ratkay LG, Khakh K, Cheng X, Gschwend HW, Kamboj R, Fu J, Winther MD.. (2013) Discovery of piperazin-1-ylpyridazine-based potent and selective stearoyl-CoA desaturase-1 inhibitors for the treatment of obesity and metabolic syndrome., 56 (2): [PMID:23245208 ] [10.1021/jm301661h ]