4-((1H-Imidazol-1-yl)methyl)-N-(4-methyl-3-((5-(phenylamino)-pyrimidin-2-yl)ethynyl)phenyl)-3-(trifluoromethyl)benzamide

ID: ALA2321908

PubChem CID: 71605223

Max Phase: Preclinical

Molecular Formula: C31H23F3N6O

Molecular Weight: 552.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2ccc(Cn3ccnc3)c(C(F)(F)F)c2)cc1C#Cc1ncc(Nc2ccccc2)cn1

Standard InChI:  InChI=1S/C31H23F3N6O/c1-21-7-11-26(15-22(21)10-12-29-36-17-27(18-37-29)38-25-5-3-2-4-6-25)39-30(41)23-8-9-24(19-40-14-13-35-20-40)28(16-23)31(32,33)34/h2-9,11,13-18,20,38H,19H2,1H3,(H,39,41)

Standard InChI Key:  ZJKZZFVTJGIADM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    2.0746  -17.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0734  -18.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7815  -18.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4911  -18.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4883  -17.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7797  -17.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3654  -18.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6580  -18.5159    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3648  -19.7423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6521  -19.3278    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3668  -17.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3666  -16.4719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1995  -18.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9066  -18.5144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0307  -15.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7780  -15.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9608  -15.2120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7085  -15.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2008  -19.7413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6149  -18.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6116  -19.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3191  -20.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0271  -19.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0232  -18.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3151  -18.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7360  -20.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7288  -18.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4301  -18.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1339  -17.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8417  -18.0756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5450  -17.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5376  -16.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8211  -16.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1207  -16.8582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2408  -16.4267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9529  -16.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9586  -17.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6698  -18.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3741  -17.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3625  -16.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6507  -16.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  1 11  1  0
 11 12  1  0
  4 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 12  1  0
 13 19  2  0
 14 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 24 27  1  0
 27 28  3  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
M  END

Associated Targets(Human)

ABL2 Tchem Tyrosine-protein kinase ABL2 (1851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABL1 Tclin Tyrosine-protein kinase ABL (18331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.56Molecular Weight (Monoisotopic): 552.1885AlogP: 6.44#Rotatable Bonds: 6
Polar Surface Area: 84.73Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.46CX LogP: 6.30CX LogD: 6.26
Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.44

References

1. Desai B, Dixon K, Farrant E, Feng Q, Gibson KR, van Hoorn WP, Mills J, Morgan T, Parry DM, Ramjee MK, Selway CN, Tarver GJ, Whitlock G, Wright AG..  (2013)  Rapid discovery of a novel series of Abl kinase inhibitors by application of an integrated microfluidic synthesis and screening platform.,  56  (7): [PMID:23441572] [10.1021/jm400099d]

Source