N-(5-(4-(4-cyanophenyl)piperidine-1-carbonyl)-2-methylphenyl)-6-(pyrrolidin-1-yl)nicotinamide

ID: ALA2322357

PubChem CID: 69166563

Max Phase: Preclinical

Molecular Formula: C30H31N5O2

Molecular Weight: 493.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)N2CCC(c3ccc(C#N)cc3)CC2)cc1NC(=O)c1ccc(N2CCCC2)nc1

Standard InChI:  InChI=1S/C30H31N5O2/c1-21-4-7-25(30(37)35-16-12-24(13-17-35)23-8-5-22(19-31)6-9-23)18-27(21)33-29(36)26-10-11-28(32-20-26)34-14-2-3-15-34/h4-11,18,20,24H,2-3,12-17H2,1H3,(H,33,36)

Standard InChI Key:  ILBQNLXITFCWDX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    4.5580   -9.4473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1107  -10.6811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9800   -9.4495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9819  -11.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2713  -10.6841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3983  -11.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2611   -9.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2666   -9.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4003  -11.9114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8104   -9.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6900   -9.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4722   -8.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6874  -10.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6706   -8.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9167  -13.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4950  -13.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7855  -12.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4932  -11.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0784  -11.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5238  -10.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2377  -11.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2074  -13.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9424  -10.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7843  -13.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3705  -12.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5315  -12.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9411   -9.8597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8146  -11.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2045  -12.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1063  -12.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6603  -11.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0772  -11.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3687  -10.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8155  -11.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6277  -13.9611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6575  -11.0878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2326  -11.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 11  2  0
  4 13  1  0
  5  4  2  0
 10  1  1  0
 11  3  1  0
  1 12  1  0
 14  7  1  0
  3  8  2  0
  8  5  1  0
  6 13  1  0
 12 14  1  0
  6  9  2  0
  2  6  1  0
  8  1  1  0
  7 10  1  0
 25 32  1  0
 34 30  1  0
 29 18  2  0
 22 29  1  0
 33 36  1  0
 36 23  1  0
 37 20  2  0
 32 19  1  0
 22 15  1  0
 31 25  1  0
 28 34  2  0
 17 32  1  0
 16 22  2  0
 23 37  1  0
 17 24  2  0
 34 26  1  0
 19 33  1  0
 26 21  2  0
 18 17  1  0
 23 27  2  0
 21 37  1  0
 20 28  1  0
 15 35  3  0
 36 31  1  0
 24 16  1  0
 28  2  1  0
M  END

Associated Targets(Human)

FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Fasn Fatty acid synthase (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 493.61Molecular Weight (Monoisotopic): 493.2478AlogP: 5.13#Rotatable Bonds: 5
Polar Surface Area: 89.33Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.79CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -2.03

References

1. Oslob JD, Johnson RJ, Cai H, Feng SQ, Hu L, Kosaka Y, Lai J, Sivaraja M, Tep S, Yang H, Zaharia CA, Evanchik MJ, McDowell RS..  (2013)  Imidazopyridine-Based Fatty Acid Synthase Inhibitors That Show Anti-HCV Activity and in Vivo Target Modulation.,  (1): [PMID:24900571] [10.1021/ml300335r]

Source