The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(2,4-dimethyl-5-(6-(methylsulfonyl)-3H-imidazo[4,5-c]pyridin-2-yl)benzoyl)piperidin-4-yl)benzonitrile ID: ALA2322362
PubChem CID: 68288699
Max Phase: Preclinical
Molecular Formula: C28H27N5O3S
Molecular Weight: 513.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(-c2nc3cc(S(C)(=O)=O)ncc3[nH]2)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1
Standard InChI: InChI=1S/C28H27N5O3S/c1-17-12-18(2)23(13-22(17)27-31-24-14-26(37(3,35)36)30-16-25(24)32-27)28(34)33-10-8-21(9-11-33)20-6-4-19(15-29)5-7-20/h4-7,12-14,16,21H,8-11H2,1-3H3,(H,31,32)
Standard InChI Key: POKZTVXFAGESFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
4.3691 -8.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8490 -7.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6946 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0445 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7207 -3.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5536 -4.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7031 -5.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3532 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5046 -8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0228 -9.3326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0082 -8.1352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8418 -9.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3372 -9.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9826 -7.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1327 -6.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6374 -6.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4787 -7.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3307 -9.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8258 -8.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4691 -7.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6173 -6.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1221 -6.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9651 -7.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1612 -7.3234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
4 6 2 0
6 7 1 0
7 8 2 0
8 2 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 11 1 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 3 0
6 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
33 25 1 0
29 34 1 0
34 35 2 0
34 36 2 0
34 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.62Molecular Weight (Monoisotopic): 513.1835AlogP: 4.54#Rotatable Bonds: 4Polar Surface Area: 119.81Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.78CX Basic pKa: 4.46CX LogP: 3.95CX LogD: 3.94Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -1.38
References 1. Oslob JD, Johnson RJ, Cai H, Feng SQ, Hu L, Kosaka Y, Lai J, Sivaraja M, Tep S, Yang H, Zaharia CA, Evanchik MJ, McDowell RS.. (2013) Imidazopyridine-Based Fatty Acid Synthase Inhibitors That Show Anti-HCV Activity and in Vivo Target Modulation., 4 (1): [PMID:24900571 ] [10.1021/ml300335r ] 2. (2014) Heterocyclic modulators of lipid synthesis,