4-(1-(3-(6-(pyrrolidin-1-yl)-3H-imidazo[4,5-c]pyridin-2-yl)benzoyl)piperidin-4-yl)benzonitrile

ID: ALA2322372

PubChem CID: 68288944

Max Phase: Preclinical

Molecular Formula: C29H28N6O

Molecular Weight: 476.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(C2CCN(C(=O)c3cccc(-c4nc5cc(N6CCCC6)ncc5[nH]4)c3)CC2)cc1

Standard InChI:  InChI=1S/C29H28N6O/c30-18-20-6-8-21(9-7-20)22-10-14-35(15-11-22)29(36)24-5-3-4-23(16-24)28-32-25-17-27(31-19-26(25)33-28)34-12-1-2-13-34/h3-9,16-17,19,22H,1-2,10-15H2,(H,32,33)

Standard InChI Key:  GUCACUBJEZUIJZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    2.0228   -9.3326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5046   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0082   -8.1352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8418   -9.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3372   -9.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9826   -7.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1327   -6.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6374   -6.7812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4787   -7.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3307   -9.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8258   -8.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4691   -7.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6173   -6.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1221   -6.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9651   -7.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1612   -7.3234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8490   -7.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6946   -5.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0445   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5536   -4.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7031   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7537    5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  3  0
  2 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 30 31  1  0
 31 23  1  0
 27 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 32  1  0
M  END

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fasn Fatty acid synthase (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 476.58Molecular Weight (Monoisotopic): 476.2325AlogP: 5.12#Rotatable Bonds: 4
Polar Surface Area: 88.91Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.59CX Basic pKa: 6.09CX LogP: 4.60CX LogD: 4.58
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.65

References

1. Oslob JD, Johnson RJ, Cai H, Feng SQ, Hu L, Kosaka Y, Lai J, Sivaraja M, Tep S, Yang H, Zaharia CA, Evanchik MJ, McDowell RS..  (2013)  Imidazopyridine-Based Fatty Acid Synthase Inhibitors That Show Anti-HCV Activity and in Vivo Target Modulation.,  (1): [PMID:24900571] [10.1021/ml300335r]
2.  (2014)  Heterocyclic modulators of lipid synthesis,