4-[2'-(3''-tert-Butyl-5'',9''-dimethyl-7''-oxo-7H-furo[3,2-g][1]benzopyran-6''-yl)acetylamino]-benzoic acid

ID: ALA2322555

PubChem CID: 71583689

Max Phase: Preclinical

Molecular Formula: C26H25NO6

Molecular Weight: 447.49

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1c(CC(=O)Nc2ccc(C(=O)O)cc2)c(=O)oc2c(C)c3occ(C(C)(C)C)c3cc12

Standard InChI:  InChI=1S/C26H25NO6/c1-13-17-10-19-20(26(3,4)5)12-32-22(19)14(2)23(17)33-25(31)18(13)11-21(28)27-16-8-6-15(7-9-16)24(29)30/h6-10,12H,11H2,1-5H3,(H,27,28)(H,29,30)

Standard InChI Key:  LLCHONWGFYAWLL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   12.9634  -23.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9616  -21.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6702  -22.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6736  -23.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3859  -23.6274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0995  -23.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0961  -22.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3792  -21.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2553  -23.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2565  -22.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4760  -22.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9924  -22.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4740  -23.4705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2247  -21.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7724  -20.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4256  -21.1933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0073  -20.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3747  -21.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8083  -23.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8026  -21.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5115  -22.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9619  -24.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5141  -23.2018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2180  -21.9738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9269  -22.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9243  -23.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6325  -23.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3399  -23.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3347  -22.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6260  -21.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0518  -23.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0554  -24.4144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7577  -23.1855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  9  1  1  0
  1  4  2  0
  3  2  2  0
  2 10  1  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
  8 18  1  0
  6 19  2  0
  7 20  1  0
 20 21  1  0
  1 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  1  0
 31 33  2  0
 28 31  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2322555

   4-[[2-(3-Tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 447.49

Molecular Weight (Monoisotopic): 447.1682

AlogP: 5.33

#Rotatable Bonds: 4

Polar Surface Area: 109.75

Molecular Species: ACID

HBA: 5

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.16

CX Basic pKa: ┄

CX LogP: 4.91

CX LogD: 1.85

Aromatic Rings: 4

Heavy Atoms: 33

QED Weighted: 0.41

Np Likeness Score: -0.74

References

1. Marzaro G, Guiotto A, Borgatti M, Finotti A, Gambari R, Breveglieri G, Chilin A..  (2013)  Psoralen derivatives as inhibitors of NF-κB/DNA interaction: synthesis, molecular modeling, 3D-QSAR, and biological evaluation.,  56  (5): [PMID:23414143] [10.1021/jm3009647]

Source

Source(1):

• Scientific Literature