The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3''-tert-Butyl-5'',9''-dimethyl-7''-oxo-7H-furo[3,2-g][1]benzopyran-6''-yl)-N-(2'-chlorobenzyl)acetamide ID: ALA2322556
PubChem CID: 23606149
Max Phase: Preclinical
Molecular Formula: C26H26ClNO4
Molecular Weight: 451.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CC(=O)NCc2ccccc2Cl)c(=O)oc2c(C)c3occ(C(C)(C)C)c3cc12
Standard InChI: InChI=1S/C26H26ClNO4/c1-14-17-10-19-20(26(3,4)5)13-31-23(19)15(2)24(17)32-25(30)18(14)11-22(29)28-12-16-8-6-7-9-21(16)27/h6-10,13H,11-12H2,1-5H3,(H,28,29)
Standard InChI Key: MQDYWACITIXNAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.3450 -23.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3432 -21.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0519 -22.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0553 -22.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7676 -23.2766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4812 -22.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4778 -22.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7609 -21.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6370 -22.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6382 -22.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8577 -21.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3740 -22.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8557 -23.1196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6064 -21.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1541 -20.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8073 -20.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3890 -20.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7564 -20.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1900 -23.2700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1842 -21.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8932 -22.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3436 -24.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8957 -22.8510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5997 -21.6230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3086 -22.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0151 -21.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7239 -22.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4299 -21.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4278 -20.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7139 -20.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0108 -20.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3007 -20.4007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9 1 1 0
1 4 2 0
3 2 2 0
2 10 1 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
11 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
8 18 1 0
6 19 2 0
7 20 1 0
20 21 1 0
1 22 1 0
21 23 2 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.95Molecular Weight (Monoisotopic): 451.1550AlogP: 5.97#Rotatable Bonds: 4Polar Surface Area: 72.45Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.57CX LogD: 5.57Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.01
References 1. Marzaro G, Guiotto A, Borgatti M, Finotti A, Gambari R, Breveglieri G, Chilin A.. (2013) Psoralen derivatives as inhibitors of NF-κB/DNA interaction: synthesis, molecular modeling, 3D-QSAR, and biological evaluation., 56 (5): [PMID:23414143 ] [10.1021/jm3009647 ]