The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-3-(2-(2-(1-allyl-2-oxoindolin-3-ylidene)hydrazinyl)-2-oxoacetamido)benzoic acid ID: ALA2323031
Cas Number: 883791-50-2
PubChem CID: 3595217
Max Phase: Preclinical
Molecular Formula: C20H16N4O5
Molecular Weight: 392.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCN1C(=O)/C(=N\NC(=O)C(=O)Nc2cccc(C(=O)O)c2)c2ccccc21
Standard InChI: InChI=1S/C20H16N4O5/c1-2-10-24-15-9-4-3-8-14(15)16(19(24)27)22-23-18(26)17(25)21-13-7-5-6-12(11-13)20(28)29/h2-9,11H,1,10H2,(H,21,25)(H,23,26)(H,28,29)/b22-16-
Standard InChI Key: VPOGUPFTDTXHJI-JWGURIENSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
33.8501 -2.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8490 -3.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5570 -3.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5552 -2.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2638 -2.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2687 -3.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0530 -3.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5331 -2.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0452 -2.1519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2932 -1.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7428 -0.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9908 0.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3502 -2.8101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3101 -4.2595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1104 -4.4247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3675 -5.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1678 -5.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8242 -5.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4248 -6.1414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7110 -4.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8816 -6.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0849 -6.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5419 -7.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7988 -7.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6038 -8.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1433 -7.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7388 -7.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4821 -6.2515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1952 -7.6376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
8 13 2 0
7 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
17 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 1 0
27 29 2 0
23 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.37Molecular Weight (Monoisotopic): 392.1121AlogP: 1.38#Rotatable Bonds: 5Polar Surface Area: 128.17Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.92CX Basic pKa: ┄CX LogP: 2.02CX LogD: -1.18Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -1.47
References 1. Zhang M, Catrow JL, Ji H.. (2013) High-Throughput Selectivity Assays for Small-Molecule Inhibitors of β-Catenin/T-Cell Factor Protein-Protein Interactions., 4 (2): [PMID:24900664 ] [10.1021/ml300367f ]