3-(1-(4-chlorobenzoyl)-5-methoxy-3-methyl-1H-indol-2-yl)-N-((trifluoromethyl)sulfonyl)-propanamide

ID: ALA2323513

PubChem CID: 71600944

Max Phase: Preclinical

Molecular Formula: C21H18ClF3N2O5S

Molecular Weight: 502.90

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)c(C)c(CCC(=O)NS(=O)(=O)C(F)(F)F)n2C(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C21H18ClF3N2O5S/c1-12-16-11-15(32-2)7-8-18(16)27(20(29)13-3-5-14(22)6-4-13)17(12)9-10-19(28)26-33(30,31)21(23,24)25/h3-8,11H,9-10H2,1-2H3,(H,26,28)

Standard InChI Key:  BOWCSHWJPAAYPZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    7.4936   -6.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4977   -7.1236    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2101   -6.7075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5228   -6.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5311   -7.6277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1978   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9478   -6.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8686   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1186   -6.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5311   -8.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0603   -7.3069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5687   -5.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8103   -8.8569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7603   -5.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4978   -6.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3462   -5.2026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5113   -5.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -5.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2430   -8.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2356   -9.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9467  -10.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6647   -9.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6673   -8.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9556   -8.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3771  -10.1203    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0228   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2603   -6.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6755   -7.1306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6755   -5.7016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9157   -7.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7406   -7.8369    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5062   -8.5566    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.3227   -8.5527    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  6  5  1  0
  7  6  2  0
  8  5  1  0
  9  8  1  0
 10  5  1  0
 11  8  2  0
 12  9  2  0
 13 10  2  0
 14 15  2  0
 15 11  1  0
 16 14  1  0
 17 16  1  0
  7  9  1  0
 12 14  1  0
  7 18  1  0
 10 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
  6 26  1  0
 26  4  1  0
  4 27  1  0
 27 28  1  0
 27 29  2  0
 28  2  1  0
  2 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(Human)

AKR1C2 Tchem Aldo-keto reductase family 1 member C2 (639 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKR1C3 Tchem Aldo-keto-reductase family 1 member C3 (1414 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 502.90Molecular Weight (Monoisotopic): 502.0577AlogP: 4.20#Rotatable Bonds: 6
Polar Surface Area: 94.47Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.06CX Basic pKa: CX LogP: 4.84CX LogD: 3.89
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -0.91

References

1. Liedtke AJ, Adeniji AO, Chen M, Byrns MC, Jin Y, Christianson DW, Marnett LJ, Penning TM..  (2013)  Development of potent and selective indomethacin analogues for the inhibition of AKR1C3 (Type 5 17β-hydroxysteroid dehydrogenase/prostaglandin F synthase) in castrate-resistant prostate cancer.,  56  (6): [PMID:23432095] [10.1021/jm3017656]
2. Adeniji, Adegoke O AO and 5 more authors.  2011-03-01  Discovery of substituted 3-(phenylamino)benzoic acids as potent and selective inhibitors of type 5 17β-hydroxysteroid dehydrogenase (AKR1C3).  [PMID:21277203]
3. Adeniji, Adegoke O AO and 6 more authors.  2012-03-08  Development of potent and selective inhibitors of aldo-keto reductase 1C3 (type 5 17β-hydroxysteroid dehydrogenase) based on N-phenyl-aminobenzoates and their structure-activity relationships.  [PMID:22263837]
4. Brožič, Petra and 7 more authors.  2012-09-13  Selective inhibitors of aldo-keto reductases AKR1C1 and AKR1C3 discovered by virtual screening of a fragment library.  [PMID:22881866]
5. Hendriks, Christine M M and 7 more authors.  2015-10-15  Pentafluorosulfanyl-containing flufenamic acid analogs: Syntheses, properties and biological activities.  [PMID:26372652]
6. Pippione, Agnese C AC and 12 more authors.  2017-10-20  Hydroxytriazole derivatives as potent and selective aldo-keto reductase 1C3 (AKR1C3) inhibitors discovered by bioisosteric scaffold hopping approach.  [PMID:28881288]
7. Endo, Satoshi S and 16 more authors.  2017-10-26  Synthesis of Potent and Selective Inhibitors of Aldo-Keto Reductase 1B10 and Their Efficacy against Proliferation, Metastasis, and Cisplatin Resistance of Lung Cancer Cells.  [PMID:28976752]
8. Pippione, Agnese Chiara AC and 15 more authors.  2018-04-25  Potent and selective aldo-keto reductase 1C3 (AKR1C3) inhibitors based on the benzoisoxazole moiety: application of a bioisosteric scaffold hopping approach to flufenamic acid.  [PMID:29602039]

Source