The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(2-Hydroxyethyl)piperazin-1-yl)methyl)-N-(3-(imidazo[1,2-a]pyridin-3-ylethynyl)-4-methylphenyl)-3-(trifluoromethyl)-benzamide ID: ALA2324931
PubChem CID: 71605407
Max Phase: Preclinical
Molecular Formula: C31H30F3N5O2
Molecular Weight: 561.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc(CN3CCN(CCO)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2ccccn12
Standard InChI: InChI=1S/C31H30F3N5O2/c1-22-5-9-26(18-23(22)8-10-27-20-35-29-4-2-3-11-39(27)29)36-30(41)24-6-7-25(28(19-24)31(32,33)34)21-38-14-12-37(13-15-38)16-17-40/h2-7,9,11,18-20,40H,12-17,21H2,1H3,(H,36,41)
Standard InChI Key: NYKXOFIGGDPRIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
15.3657 -29.7202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3657 -30.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0710 -30.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7762 -30.5374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7762 -29.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0710 -29.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6568 -29.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4833 -30.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1916 -30.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8971 -30.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6049 -30.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6066 -29.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8945 -29.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1896 -29.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8950 -31.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1862 -32.1738 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.6016 -32.1776 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.8903 -32.5803 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.3143 -29.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0220 -29.7251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3144 -28.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7297 -29.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4362 -29.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1435 -29.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1440 -28.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4314 -28.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7270 -28.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8512 -28.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8509 -29.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5549 -30.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2625 -30.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3500 -31.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1493 -31.5223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0113 -30.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5542 -30.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3490 -30.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6019 -29.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0540 -29.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2613 -29.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6544 -28.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9455 -28.0899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
4 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
15 16 1 0
15 17 1 0
15 18 1 0
12 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
24 29 1 0
29 30 3 0
30 31 1 0
31 32 2 0
32 33 1 0
33 35 2 0
34 31 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
7 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.61Molecular Weight (Monoisotopic): 561.2352AlogP: 4.42#Rotatable Bonds: 6Polar Surface Area: 73.11Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.40CX LogP: 4.38CX LogD: 4.08Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.34Np Likeness Score: -1.62
References 1. Desai B, Dixon K, Farrant E, Feng Q, Gibson KR, van Hoorn WP, Mills J, Morgan T, Parry DM, Ramjee MK, Selway CN, Tarver GJ, Whitlock G, Wright AG.. (2013) Rapid discovery of a novel series of Abl kinase inhibitors by application of an integrated microfluidic synthesis and screening platform., 56 (7): [PMID:23441572 ] [10.1021/jm400099d ]