The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1H-Imidazol-1-yl)methyl)-N-(4-methyl-3-(pyrimidin-5-ylethynyl)phenyl)-3-(trifluoromethyl)benzamide ID: ALA2324932
PubChem CID: 71605408
Max Phase: Preclinical
Molecular Formula: C25H18F3N5O
Molecular Weight: 461.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc(Cn3ccnc3)c(C(F)(F)F)c2)cc1C#Cc1cncnc1
Standard InChI: InChI=1S/C25H18F3N5O/c1-17-2-7-22(10-19(17)4-3-18-12-30-15-31-13-18)32-24(34)20-5-6-21(14-33-9-8-29-16-33)23(11-20)25(26,27)28/h2,5-13,15-16H,14H2,1H3,(H,32,34)
Standard InChI Key: FRSWPGKMMGVEGT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.2149 -3.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2138 -4.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9218 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6315 -4.2116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6286 -3.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9200 -2.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5057 -4.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7983 -4.2110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5051 -5.4373 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7924 -5.0228 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5071 -2.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5069 -2.1669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3398 -4.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0469 -4.2094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1710 -1.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9183 -0.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1011 -0.9070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8489 -1.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3411 -5.4363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7552 -4.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7519 -5.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4594 -5.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1674 -5.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1635 -4.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4554 -4.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8763 -5.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8691 -4.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5704 -3.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2742 -3.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9820 -3.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6853 -3.3560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6779 -2.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9614 -2.1363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2610 -2.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
7 9 1 0
7 10 1 0
1 11 1 0
11 12 1 0
4 13 1 0
13 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
13 19 2 0
14 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
24 27 1 0
27 28 3 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.45Molecular Weight (Monoisotopic): 461.1463AlogP: 4.70#Rotatable Bonds: 4Polar Surface Area: 72.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.46CX LogP: 4.48CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.68
References 1. Desai B, Dixon K, Farrant E, Feng Q, Gibson KR, van Hoorn WP, Mills J, Morgan T, Parry DM, Ramjee MK, Selway CN, Tarver GJ, Whitlock G, Wright AG.. (2013) Rapid discovery of a novel series of Abl kinase inhibitors by application of an integrated microfluidic synthesis and screening platform., 56 (7): [PMID:23441572 ] [10.1021/jm400099d ]