The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(4-(2-chlorophenyl)-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl)ethyl)-5-p-tolyl-1,3,4-oxadiazole ID: ALA2325499
PubChem CID: 49833459
Max Phase: Preclinical
Molecular Formula: C24H19ClN6O
Molecular Weight: 442.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2nnc(CCc3nnc(-c4ccncc4)n3-c3ccccc3Cl)o2)cc1
Standard InChI: InChI=1S/C24H19ClN6O/c1-16-6-8-18(9-7-16)24-30-28-22(32-24)11-10-21-27-29-23(17-12-14-26-15-13-17)31(21)20-5-3-2-4-19(20)25/h2-9,12-15H,10-11H2,1H3
Standard InChI Key: BSGNOJZPCZALIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
18.6908 -11.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6897 -12.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3977 -12.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1074 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1045 -11.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3959 -11.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3961 -13.6504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7349 -14.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9873 -14.9078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8045 -14.9080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0571 -14.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8313 -13.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4384 -14.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2150 -14.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3857 -13.3745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7736 -12.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9993 -13.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9578 -13.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3504 -14.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5733 -14.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3214 -13.3925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5042 -13.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2515 -14.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9126 -14.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4736 -14.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8665 -13.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0933 -14.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9255 -14.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5313 -15.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3056 -15.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9816 -12.8333 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.1507 -15.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
3 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 12 1 0
8 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 25 1 0
2 31 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.91Molecular Weight (Monoisotopic): 442.1309AlogP: 5.13#Rotatable Bonds: 6Polar Surface Area: 82.52Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.77CX LogP: 3.97CX LogD: 3.97Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.91
References 1. Voronkov A, Holsworth DD, Waaler J, Wilson SR, Ekblad B, Perdreau-Dahl H, Dinh H, Drewes G, Hopf C, Morth JP, Krauss S.. (2013) Structural basis and SAR for G007-LK, a lead stage 1,2,4-triazole based specific tankyrase 1/2 inhibitor., 56 (7): [PMID:23473363 ] [10.1021/jm4000566 ]