The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
perviridisinol C ID: ALA2331817
PubChem CID: 71658236
Max Phase: Preclinical
Molecular Formula: C30H50O2
Molecular Weight: 442.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Perviridisinol C | Perviridisinol C|CHEMBL2331817
Canonical SMILES: C=C(CC[C@@H](CO)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4[C@H](C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C)C(C)C
Standard InChI: InChI=1S/C30H50O2/c1-19(2)20(3)7-8-22(17-31)24-11-13-28(6)26-10-9-23-21(4)25(32)12-14-29(23)18-30(26,29)16-15-27(24,28)5/h19,21-26,31-32H,3,7-18H2,1-2,4-6H3/t21-,22-,23-,24+,25-,26-,27+,28-,29+,30-/m0/s1
Standard InChI Key: UIAGZIIGWMBFBA-RODLHURISA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
22.1753 -17.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0378 -18.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0378 -19.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1753 -18.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7503 -18.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4629 -18.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9629 -17.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7503 -20.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4629 -17.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4629 -19.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7503 -17.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9629 -18.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3253 -18.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4503 -18.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3253 -20.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4004 -16.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1753 -16.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6128 -18.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6128 -19.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0378 -18.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8878 -20.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2254 -16.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9629 -16.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4629 -18.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.1753 -19.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7878 -17.4211 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.3212 -19.3253 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.3501 -15.2843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6522 -17.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4770 -17.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9039 -18.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8751 -16.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5059 -18.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7288 -18.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3253 -20.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 11 1 0
6 4 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 6 1 0
11 9 1 0
12 4 1 0
13 2 1 0
14 7 1 0
15 3 1 0
16 7 1 0
1 17 1 1
18 13 1 0
19 18 1 0
2 20 1 1
19 21 1 1
22 16 1 0
16 23 1 6
6 24 1 1
4 25 1 6
7 26 1 6
12 14 1 0
6 5 1 0
3 8 1 0
15 19 1 0
3 27 1 6
5 20 1 1
23 28 1 0
22 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
31 34 1 0
15 35 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.73Molecular Weight (Monoisotopic): 442.3811AlogP: 7.00#Rotatable Bonds: 6Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.16CX LogD: 6.16Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: 3.69
References 1. Pan L, Acuña UM, Li J, Jena N, Ninh TN, Pannell CM, Chai H, Fuchs JR, Carcache de Blanco EJ, Soejarto DD, Kinghorn AD.. (2013) Bioactive flavaglines and other constituents isolated from Aglaia perviridis., 76 (3): [PMID:23301897 ] [10.1021/np3007588 ]