argenteanol

ID: ALA2331819

PubChem CID: 71716958

Max Phase: Preclinical

Molecular Formula: C30H50O4

Molecular Weight: 474.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Argenteanol | Argenteanol|CHEMBL2331819

Canonical SMILES:  CC(C)=C[C@H](O)[C@@H](O)[C@@H](CO)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C

Standard InChI:  InChI=1S/C30H50O4/c1-18(2)15-21(32)25(34)19(16-31)20-9-11-28(6)23-8-7-22-26(3,4)24(33)10-12-29(22)17-30(23,29)14-13-27(20,28)5/h15,19-25,31-34H,7-14,16-17H2,1-6H3/t19-,20+,21-,22-,23-,24-,25-,27+,28-,29+,30-/m0/s1

Standard InChI Key:  YAPWNPLDLBUZDW-XECJJSHOSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    6.8718   -3.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7422   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7422   -5.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8718   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4521   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1620   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560   -3.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4521   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1620   -2.8932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1620   -5.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4521   -3.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560   -4.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0323   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1389   -3.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0323   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0894   -2.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8718   -2.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3224   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3224   -5.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7422   -3.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6043   -5.7699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9107   -2.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560   -1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1620   -3.7145    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8718   -4.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4773   -3.0541    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6196   -6.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4409   -6.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0282   -4.9485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3090   -1.6119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3376   -3.0353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9393   -3.7511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1588   -3.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5816   -3.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4027   -3.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1874   -4.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0415   -0.9303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  2  1  0
  4  1  1  0
  5 11  1  0
  6  4  1  0
  7  1  1  0
  8 10  1  0
  9  1  1  0
 10  6  1  0
 11  9  1  0
 12  4  1  0
 13  2  1  0
 14  7  1  0
 15  3  1  0
 16  7  1  0
  1 17  1  1
 18 13  1  0
 19 18  1  0
  2 20  1  1
 19 21  1  1
 22 16  1  0
 16 23  1  6
  6 24  1  1
  4 25  1  6
  7 26  1  6
 12 14  1  0
  6  5  1  0
  3  8  1  0
 15 19  1  0
 15 27  1  0
 15 28  1  0
  3 29  1  6
  5 20  1  1
 22 30  1  6
 22 31  1  0
 31 32  1  6
 31 33  1  0
 33 34  2  0
 34 35  1  0
 34 36  1  0
 23 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2331819

    ARGENTEANOL

Associated Targets(Human)

RELA Tchem Nuclear factor NF-kappa-B p65 subunit (627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.73Molecular Weight (Monoisotopic): 474.3709AlogP: 5.08#Rotatable Bonds: 5
Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.51CX Basic pKa: CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: 3.14

References

1. Pan L, Acuña UM, Li J, Jena N, Ninh TN, Pannell CM, Chai H, Fuchs JR, Carcache de Blanco EJ, Soejarto DD, Kinghorn AD..  (2013)  Bioactive flavaglines and other constituents isolated from Aglaia perviridis.,  76  (3): [PMID:23301897] [10.1021/np3007588]

Source