The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
24-methylenecycloartan-3beta,21-diol ID: ALA2331820
PubChem CID: 71716352
Max Phase: Preclinical
Molecular Formula: C31H52O2
Molecular Weight: 456.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(CC[C@@H](CO)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C)C(C)C
Standard InChI: InChI=1S/C31H52O2/c1-20(2)21(3)8-9-22(18-32)23-12-14-29(7)25-11-10-24-27(4,5)26(33)13-15-30(24)19-31(25,30)17-16-28(23,29)6/h20,22-26,32-33H,3,8-19H2,1-2,4-7H3/t22-,23+,24-,25-,26-,28+,29-,30+,31-/m0/s1
Standard InChI Key: FJXNINQGUTYPNE-DLJSKDEVSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.5045 -4.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3749 -5.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3749 -6.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -4.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -4.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7946 -5.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2887 -3.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -6.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7946 -3.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7946 -6.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -4.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2887 -5.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6650 -4.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7716 -4.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6650 -6.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7220 -3.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -3.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9551 -5.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9551 -6.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3749 -4.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2370 -6.6036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5434 -3.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2887 -2.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7946 -4.5482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -5.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1100 -3.8878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.2523 -7.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0736 -7.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6609 -5.7822 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.9703 -3.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7914 -3.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2143 -4.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0354 -4.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8200 -5.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6742 -1.7640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1857 -3.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 11 1 0
6 4 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 6 1 0
11 9 1 0
12 4 1 0
13 2 1 0
14 7 1 0
15 3 1 0
16 7 1 0
1 17 1 1
18 13 1 0
19 18 1 0
2 20 1 1
19 21 1 1
22 16 1 0
16 23 1 6
6 24 1 1
4 25 1 6
7 26 1 6
12 14 1 0
6 5 1 0
3 8 1 0
15 19 1 0
15 27 1 0
15 28 1 0
3 29 1 6
5 20 1 1
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
23 35 1 0
31 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.76Molecular Weight (Monoisotopic): 456.3967AlogP: 7.39#Rotatable Bonds: 6Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.53CX LogD: 6.53Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: 3.37
References 1. Pan L, Acuña UM, Li J, Jena N, Ninh TN, Pannell CM, Chai H, Fuchs JR, Carcache de Blanco EJ, Soejarto DD, Kinghorn AD.. (2013) Bioactive flavaglines and other constituents isolated from Aglaia perviridis., 76 (3): [PMID:23301897 ] [10.1021/np3007588 ]