The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+)-Aplysamine 7 ID: ALA2332123
PubChem CID: 71665144
Max Phase: Preclinical
Molecular Formula: C23H28Br3N3O5
Molecular Weight: 666.21
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: (+)-Aplysamine 7 | (+)-Aplysamine 7|CHEMBL2332123
Canonical SMILES: COc1ccc(C/C(=N\O)C(=O)NC[C@@H](O)c2cc(Br)c(OCCCN(C)C)c(Br)c2)cc1Br
Standard InChI: InChI=1S/C23H28Br3N3O5/c1-29(2)7-4-8-34-22-17(25)11-15(12-18(22)26)20(30)13-27-23(31)19(28-32)10-14-5-6-21(33-3)16(24)9-14/h5-6,9,11-12,20,30,32H,4,7-8,10,13H2,1-3H3,(H,27,31)/b28-19+/t20-/m1/s1
Standard InChI Key: FZBQAWDXVQGOIC-WDMWBOBFSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
15.2718 -2.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2706 -3.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9860 -3.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7030 -3.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7002 -2.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9842 -2.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9818 -1.4797 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
14.5594 -3.9568 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
14.5608 -2.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8458 -2.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1307 -2.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4158 -2.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7006 -2.3058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9857 -2.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7004 -1.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4147 -3.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4156 -4.7789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1292 -3.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8447 -3.9522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5593 -3.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2707 -3.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5584 -2.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2716 -4.7756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9872 -5.1894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9852 -3.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7008 -3.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6974 -4.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4121 -5.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1276 -4.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1240 -3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4088 -3.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8372 -3.5281 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
23.8437 -5.1839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8457 -6.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
2 8 1 0
1 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
4 16 1 0
16 17 1 1
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
21 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
29 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 666.21Molecular Weight (Monoisotopic): 662.9579AlogP: 4.54#Rotatable Bonds: 12Polar Surface Area: 103.62Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.09CX Basic pKa: 9.29CX LogP: 3.28CX LogD: 2.72Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: 0.06
References 1. Tran TD, Pham NB, Fechner G, Hooper JN, Quinn RJ.. (2013) Bromotyrosine alkaloids from the Australian marine sponge Pseudoceratina verrucosa., 76 (4): [PMID:23489291 ] [10.1021/np300648d ]