8beta-O-methyl-4'-demethoxy-3',4'-methylenedioxyrocaglaol

ID: ALA2332221

PubChem CID: 71658107

Max Phase: Preclinical

Molecular Formula: C27H26O7

Molecular Weight: 462.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c2c(c1)O[C@@]1(c3ccc4c(c3)OCO4)[C@H](c3ccccc3)C[C@@H](O)[C@@]21OC

Standard InChI:  InChI=1S/C27H26O7/c1-29-18-12-22(30-2)25-23(13-18)34-26(17-9-10-20-21(11-17)33-15-32-20)19(16-7-5-4-6-8-16)14-24(28)27(25,26)31-3/h4-13,19,24,28H,14-15H2,1-3H3/t19-,24+,26-,27+/m0/s1

Standard InChI Key:  SKVASQVJEVFEOC-KTWRFPGGSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   28.6498   -3.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6487   -4.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3608   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3590   -2.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3566   -2.0757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9365   -4.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2250   -4.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0677   -3.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0725   -4.1291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8566   -4.3776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8489   -3.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3399   -3.7069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1202   -3.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1131   -2.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3284   -2.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7466   -4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8479   -3.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8796   -4.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6065   -5.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3023   -4.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2664   -3.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5391   -3.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3303   -5.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9625   -5.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5582   -4.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5534   -5.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7388   -5.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4823   -6.6064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1410   -7.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8019   -6.6096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6436   -1.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3614   -2.3890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3558   -1.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5362   -1.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  9  2  0
  8  4  2  0
  4  1  1  0
  4  5  1  0
  2  6  1  0
  6  7  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11  8  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 12 16  1  1
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 17  1  1
 16 23  2  0
 23 27  1  0
 26 24  1  0
 24 25  2  0
 25 16  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
  5 31  1  0
 11 32  1  1
 32 33  1  0
 15 34  1  6
M  END

Associated Targets(Human)

RELA Tchem Nuclear factor NF-kappa-B p65 subunit (627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.50Molecular Weight (Monoisotopic): 462.1679AlogP: 4.11#Rotatable Bonds: 5
Polar Surface Area: 75.61Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.69CX Basic pKa: CX LogP: 3.79CX LogD: 3.79
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: 1.53

References

1. Pan L, Acuña UM, Li J, Jena N, Ninh TN, Pannell CM, Chai H, Fuchs JR, Carcache de Blanco EJ, Soejarto DD, Kinghorn AD..  (2013)  Bioactive flavaglines and other constituents isolated from Aglaia perviridis.,  76  (3): [PMID:23301897] [10.1021/np3007588]

Source