3-(3',5'-Di-tert-butyl-4'-hydroxy-4-biphenyl)octahydropyrido-[2,1-c][1,4]oxazin-3-ol Hydrobromide

ID: ALA2332555

PubChem CID: 71624093

Max Phase: Preclinical

Molecular Formula: C28H40BrNO3

Molecular Weight: 437.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Br.CC(C)(C)c1cc(-c2ccc(C3(O)CN4CCCCC4CO3)cc2)cc(C(C)(C)C)c1O

Standard InChI:  InChI=1S/C28H39NO3.BrH/c1-26(2,3)23-15-20(16-24(25(23)30)27(4,5)6)19-10-12-21(13-11-19)28(31)18-29-14-8-7-9-22(29)17-32-28;/h10-13,15-16,22,30-31H,7-9,14,17-18H2,1-6H3;1H

Standard InChI Key:  IAKIULQHWXPEBH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    4.2222  -10.6441    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    7.3368   -8.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3357   -9.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0437  -10.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7534   -9.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7505   -8.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0419   -8.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6311   -8.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6322   -7.7212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9252   -7.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2166   -7.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2195   -8.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9270   -8.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5053   -7.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5059   -6.4969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8017   -6.0895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8003   -7.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0915   -7.3139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0887   -6.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3861   -6.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6818   -6.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6846   -7.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -7.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2086   -6.9007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4617  -10.1743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0435  -10.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3357  -11.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7511  -11.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0357  -11.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4567   -8.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1659   -8.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4536   -7.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1612   -8.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  2  8  1  0
 14 15  1  0
 14 17  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 11 14  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 14 24  1  0
  5 25  1  0
  4 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  6 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(non-human)

Fdft1 Squalene synthetase (891 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (8692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.62Molecular Weight (Monoisotopic): 437.2930AlogP: 5.68#Rotatable Bonds: 2
Polar Surface Area: 52.93Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.74CX Basic pKa: 6.95CX LogP: 6.91CX LogD: 6.78
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: 0.35

References

1. Ladopoulou E, Matralis AN, Kourounakis AP..  (2013)  New multifunctional Di-tert-butylphenoloctahydro(pyrido/benz)oxazine derivatives with antioxidant, antihyperlipidemic, and antidiabetic action.,  56  (8): [PMID:23581491] [10.1021/jm400101e]

Source