The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3',5'-Di-tert-butyl-4'hydroxy-4-biphenyl)-4-methyloctahydro-1,4-benzoxazin-2-ol Hydrobromide ID: ALA2332556
PubChem CID: 60162272
Max Phase: Preclinical
Molecular Formula: C29H42BrNO3
Molecular Weight: 451.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Br.CN1CC(O)(c2ccc(-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cc2)OC2CCCCC21
Standard InChI: InChI=1S/C29H41NO3.BrH/c1-27(2,3)22-16-20(17-23(26(22)31)28(4,5)6)19-12-14-21(15-13-19)29(32)18-30(7)24-10-8-9-11-25(24)33-29;/h12-17,24-25,31-32H,8-11,18H2,1-7H3;1H
Standard InChI Key: CNFRXVLYDLPPCN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
16.3067 -11.2632 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
19.5286 -10.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5275 -11.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2355 -11.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9452 -11.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9424 -10.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2337 -10.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8229 -10.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8240 -9.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1171 -8.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4085 -9.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4113 -10.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1188 -10.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6971 -8.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6978 -7.9580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9921 -9.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2833 -8.7749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4004 -8.3618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6535 -11.6354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2353 -12.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5275 -12.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9429 -12.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2275 -13.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6485 -9.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3578 -10.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6454 -9.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3531 -9.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2805 -7.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9920 -7.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9937 -6.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2857 -6.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5743 -6.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5708 -7.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5758 -9.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
2 8 1 0
14 15 1 0
14 16 1 0
15 29 1 0
17 16 1 0
11 14 1 0
17 28 1 0
14 18 1 0
5 19 1 0
4 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
6 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
17 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.65Molecular Weight (Monoisotopic): 451.3086AlogP: 6.07#Rotatable Bonds: 2Polar Surface Area: 52.93Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.74CX Basic pKa: 7.38CX LogP: 7.41CX LogD: 7.12Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: 0.55
References 1. Ladopoulou E, Matralis AN, Kourounakis AP.. (2013) New multifunctional Di-tert-butylphenoloctahydro(pyrido/benz)oxazine derivatives with antioxidant, antihyperlipidemic, and antidiabetic action., 56 (8): [PMID:23581491 ] [10.1021/jm400101e ]