The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-O-Dipentyldiorcinol ID: ALA2332627
PubChem CID: 71665419
Max Phase: Preclinical
Molecular Formula: C24H34O3
Molecular Weight: 370.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 3,3'-O-Dipentyldiorcinol | 3,3'-O-Dipentyldiorcinol|CHEMBL2332627
Canonical SMILES: CCCCCOc1cc(C)cc(Oc2cc(C)cc(OCCCCC)c2)c1
Standard InChI: InChI=1S/C24H34O3/c1-5-7-9-11-25-21-13-19(3)15-23(17-21)27-24-16-20(4)14-22(18-24)26-12-10-8-6-2/h13-18H,5-12H2,1-4H3
Standard InChI Key: DSZVHBOSGUHTTC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
16.0943 -16.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0931 -17.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8079 -18.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5243 -17.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5215 -16.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8061 -16.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2344 -16.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9504 -16.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9502 -17.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6653 -18.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3792 -17.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3734 -16.9369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6577 -16.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8077 -19.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6680 -19.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0849 -16.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3797 -16.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0788 -15.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7902 -15.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5077 -15.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2191 -15.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9366 -15.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6653 -16.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9507 -16.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2363 -16.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5218 -16.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8074 -16.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 14 1 0
10 15 1 0
12 16 1 0
1 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.53Molecular Weight (Monoisotopic): 370.2508AlogP: 7.23#Rotatable Bonds: 12Polar Surface Area: 27.69Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.72CX LogD: 7.72Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.37Np Likeness Score: -0.22
References 1. Chen M, Shao CL, Fu XM, Xu RF, Zheng JJ, Zhao DL, She ZG, Wang CY.. (2013) Bioactive indole alkaloids and phenyl ether derivatives from a marine-derived Aspergillus sp. Fungus., 76 (4): [PMID:23527875 ] [10.1021/np300707x ]