The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3,5,6-Tetrafluoro-4-(phenylsulfonyl)-benzenesulfonamide ID: ALA2333816
PubChem CID: 71584326
Max Phase: Preclinical
Molecular Formula: C12H7F4NO4S2
Molecular Weight: 369.32
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1c(F)c(F)c(S(=O)(=O)c2ccccc2)c(F)c1F
Standard InChI: InChI=1S/C12H7F4NO4S2/c13-7-9(15)12(23(17,20)21)10(16)8(14)11(7)22(18,19)6-4-2-1-3-5-6/h1-5H,(H2,17,20,21)
Standard InChI Key: FBNVGSUZKKTWEQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
23 24 0 0 0 0 0 0 0 0999 V2000
25.6988 -8.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6977 -9.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4057 -9.5531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1154 -9.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1126 -8.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4039 -7.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4015 -7.0985 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.1080 -6.6878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6053 -7.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9850 -6.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8187 -7.9097 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.9910 -7.9162 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.9897 -9.5522 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.8237 -9.5511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.4055 -10.3703 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.6977 -10.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9935 -10.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2862 -10.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2856 -11.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9982 -12.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7026 -11.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1902 -10.1530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9797 -10.9454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 2 0
7 10 2 0
5 11 1 0
1 12 1 0
2 13 1 0
4 14 1 0
3 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 22 2 0
15 23 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 369.32Molecular Weight (Monoisotopic): 368.9753AlogP: 1.72#Rotatable Bonds: 3Polar Surface Area: 94.30Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.52CX Basic pKa: ┄CX LogP: 2.10CX LogD: 1.20Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.66Np Likeness Score: -1.11
References 1. Dudutienė V, Zubrienė A, Smirnov A, Gylytė J, Timm D, Manakova E, Gražulis S, Matulis D.. (2013) 4-Substituted-2,3,5,6-tetrafluorobenzenesulfonamides as inhibitors of carbonic anhydrases I, II, VII, XII, and XIII., 21 (7): [PMID:23394791 ] [10.1016/j.bmc.2013.01.008 ]