2-((2-(4-(1H-imidazol-1-yl)phenoxy)ethyl)(benzo[d][1,3]dioxol-5-ylmethyl)amino)-N-(3-(2-methylpiperidin-1-yl)propyl)acetamide

ID: ALA233441

PubChem CID: 10414738

Max Phase: Preclinical

Molecular Formula: C30H39N5O4

Molecular Weight: 533.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CCCCN1CCCNC(=O)CN(CCOc1ccc(-n2ccnc2)cc1)Cc1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C30H39N5O4/c1-24-5-2-3-14-34(24)15-4-12-32-30(36)21-33(20-25-6-11-28-29(19-25)39-23-38-28)17-18-37-27-9-7-26(8-10-27)35-16-13-31-22-35/h6-11,13,16,19,22,24H,2-5,12,14-15,17-18,20-21,23H2,1H3,(H,32,36)

Standard InChI Key:  NWNRAEPFIKOHBQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    0.4487  -20.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1668  -21.1980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1639  -22.0288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4511  -22.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2631  -22.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9800  -22.4372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6941  -22.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6968  -21.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4047  -20.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1256  -21.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1280  -22.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4096  -22.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8381  -20.7885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9576  -19.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7695  -19.8327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1505  -20.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5838  -21.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8781  -22.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8794  -23.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1642  -23.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608  -24.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5896  -23.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5875  -24.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8786  -24.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0537  -25.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8702  -25.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2031  -25.0651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4525  -19.9554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2664  -21.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1677  -19.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8790  -19.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5942  -19.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3056  -19.9685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2967  -20.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0040  -21.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7215  -20.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7273  -19.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0155  -19.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5798  -21.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 19  1  0
  5  6  1  0
 19 20  2  0
  7 12  1  0
 20 21  1  0
 21 24  2  0
  8  9  1  0
 23 22  2  0
 22 19  1  0
 23 24  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
  1  2  1  0
 10 13  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 13 14  1  0
  1 28  1  0
  6  7  1  0
  1 29  2  0
  7  8  2  0
 28 30  1  0
  3  4  1  0
 30 31  1  0
 31 32  1  0
 14 15  2  0
 32 33  1  0
 33 34  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  4  5  1  0
  3 18  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
  2  3  1  0
 34 39  1  0
M  END

Associated Targets(Human)

A 172 (535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.67Molecular Weight (Monoisotopic): 533.3002AlogP: 3.86#Rotatable Bonds: 13
Polar Surface Area: 81.09Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.49CX LogP: 3.19CX LogD: 1.01
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.78

References

1. Wei RG, Adler M, Davey D, Ho E, Mohan R, Polokoff M, Tseng JL, Whitlow M, Xu W, Yuan S, Phillips G..  (2007)  1-(1,3-Benzodioxol-5-ylmethyl)-3-[4-(1H-imidazol-1-yl)phenoxy]-piperidine analogs as potent and selective inhibitors of nitric oxide formation.,  17  (9): [PMID:17368901] [10.1016/j.bmcl.2007.02.053]

Source