The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-(4-(1H-imidazol-1-yl)phenoxy)ethyl)(benzo[d][1,3]dioxol-5-ylmethyl)amino)-N-(3-(2-methylpiperidin-1-yl)propyl)acetamide ID: ALA233441
PubChem CID: 10414738
Max Phase: Preclinical
Molecular Formula: C30H39N5O4
Molecular Weight: 533.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1CCCCN1CCCNC(=O)CN(CCOc1ccc(-n2ccnc2)cc1)Cc1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C30H39N5O4/c1-24-5-2-3-14-34(24)15-4-12-32-30(36)21-33(20-25-6-11-28-29(19-25)39-23-38-28)17-18-37-27-9-7-26(8-10-27)35-16-13-31-22-35/h6-11,13,16,19,22,24H,2-5,12,14-15,17-18,20-21,23H2,1H3,(H,32,36)
Standard InChI Key: NWNRAEPFIKOHBQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
0.4487 -20.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1668 -21.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1639 -22.0288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4511 -22.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2631 -22.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9800 -22.4372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6941 -22.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6968 -21.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4047 -20.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1256 -21.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1280 -22.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4096 -22.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8381 -20.7885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9576 -19.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7695 -19.8327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1505 -20.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5838 -21.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8781 -22.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8794 -23.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1642 -23.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1608 -24.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5896 -23.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -24.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8786 -24.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0537 -25.7264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8702 -25.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2031 -25.0651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4525 -19.9554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2664 -21.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1677 -19.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8790 -19.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5942 -19.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3056 -19.9685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2967 -20.7903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0040 -21.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7215 -20.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7273 -19.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0155 -19.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5798 -21.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
5 6 1 0
19 20 2 0
7 12 1 0
20 21 1 0
21 24 2 0
8 9 1 0
23 22 2 0
22 19 1 0
23 24 1 0
9 10 2 0
10 11 1 0
11 12 2 0
1 2 1 0
10 13 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
13 14 1 0
1 28 1 0
6 7 1 0
1 29 2 0
7 8 2 0
28 30 1 0
3 4 1 0
30 31 1 0
31 32 1 0
14 15 2 0
32 33 1 0
33 34 1 0
15 16 1 0
16 17 2 0
17 13 1 0
4 5 1 0
3 18 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
2 3 1 0
34 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.67Molecular Weight (Monoisotopic): 533.3002AlogP: 3.86#Rotatable Bonds: 13Polar Surface Area: 81.09Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.49CX LogP: 3.19CX LogD: 1.01Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.78
References 1. Wei RG, Adler M, Davey D, Ho E, Mohan R, Polokoff M, Tseng JL, Whitlow M, Xu W, Yuan S, Phillips G.. (2007) 1-(1,3-Benzodioxol-5-ylmethyl)-3-[4-(1H-imidazol-1-yl)phenoxy]-piperidine analogs as potent and selective inhibitors of nitric oxide formation., 17 (9): [PMID:17368901 ] [10.1016/j.bmcl.2007.02.053 ]