The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cryptobeilic acid A ID: ALA2334425
PubChem CID: 71521966
Max Phase: Preclinical
Molecular Formula: C20H28O3
Molecular Weight: 316.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Cryptobeilic Acid A | hexyl(hydroxy)[?]carboxylic acid|Cryptobeilic Acid A|CHEMBL2334425
Canonical SMILES: CCCCCC[C@@H]1[C@H]2C=C[C@H]3C(C(=O)O)=C[C@H](O)[C@@H]4C[C@@H]1[C@@H]2[C@H]43
Standard InChI: InChI=1S/C20H28O3/c1-2-3-4-5-6-11-12-7-8-13-15(20(22)23)10-17(21)16-9-14(11)18(12)19(13)16/h7-8,10-14,16-19,21H,2-6,9H2,1H3,(H,22,23)/t11-,12-,13+,14+,16+,17+,18-,19+/m1/s1
Standard InChI Key: CFVWGWLCFBEENY-VTUNUVLBSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
3.6774 -5.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -6.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3826 -5.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0879 -5.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4965 -6.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 -5.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7935 -5.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3826 -4.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0903 -4.1974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6749 -4.1974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2952 -5.0435 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.7884 -7.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0844 -6.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3827 -7.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6391 -7.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5690 -7.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7971 -7.6354 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 -6.4343 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.7822 -6.2445 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.3134 -6.6572 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2816 -7.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5675 -8.6342 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9860 -7.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9701 -7.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9793 -8.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6836 -9.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3946 -8.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 -9.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8100 -8.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 14 1 0
4 3 1 0
4 13 1 0
4 7 1 0
12 5 1 0
5 6 1 0
6 7 2 0
3 8 1 0
8 9 2 0
8 10 1 0
4 11 1 1
13 14 1 0
12 13 1 0
14 15 1 0
15 16 1 0
16 12 1 0
14 17 1 6
13 18 1 1
12 19 1 1
5 20 1 1
5 21 1 0
21 16 1 0
16 22 1 1
21 23 1 1
2 24 1 1
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 316.44Molecular Weight (Monoisotopic): 316.2038AlogP: 3.64#Rotatable Bonds: 6Polar Surface Area: 57.53Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.27CX Basic pKa: ┄CX LogP: 3.51CX LogD: 0.53Aromatic Rings: ┄Heavy Atoms: 23QED Weighted: 0.58Np Likeness Score: 2.71
References 1. Talontsi FM, Lamshöft M, Bauer JO, Razakarivony AA, Andriamihaja B, Strohmann C, Spiteller M.. (2013) Antibacterial and antiplasmodial constituents of Beilschmiedia cryptocaryoides., 76 (1): [PMID:23320609 ] [10.1021/np300773x ]