2-((8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl 3-phenylpropanoate

ID: ALA2335073

PubChem CID: 71567386

Max Phase: Preclinical

Molecular Formula: C30H36O6

Molecular Weight: 492.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)COC(=O)CCc1ccccc1

Standard InChI:  InChI=1S/C30H36O6/c1-28-14-12-21(31)16-20(28)9-10-22-23-13-15-30(35,29(23,2)17-24(32)27(22)28)25(33)18-36-26(34)11-8-19-6-4-3-5-7-19/h3-7,12,14,16,22-24,27,32,35H,8-11,13,15,17-18H2,1-2H3/t22-,23-,24-,27+,28-,29-,30-/m0/s1

Standard InChI Key:  AKWXQEKPDMQPRV-WXWSXMEKSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    5.2416  -19.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -20.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0216  -18.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5276  -20.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2333  -19.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8094  -19.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -21.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5276  -18.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8094  -19.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4062  -19.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4062  -21.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4220  -18.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4963  -19.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0092  -20.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5276  -21.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7045  -20.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7045  -21.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8218  -21.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2350  -18.2011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9988  -21.6102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8306  -18.9110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2333  -18.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -18.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1037  -19.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0092  -17.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4096  -16.7937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2209  -20.7889    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5234  -19.5754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8094  -20.7806    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2268  -16.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6300  -16.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6407  -17.4921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4471  -16.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8611  -16.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4560  -17.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8693  -18.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6873  -18.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0903  -17.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6747  -16.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  1  0
  3  1  1  0
  4  5  1  0
  5  1  1  0
  6  9  1  0
  7  2  1  0
  8  1  1  0
  9  8  1  0
 10  2  1  0
 11  7  2  0
  3 12  1  1
 13  3  1  0
 14  5  1  0
 15  4  1  0
 16 10  2  0
 17 16  1  0
 18 15  1  0
 19 12  2  0
 20 17  2  0
 21  3  1  0
  1 22  1  1
  9 23  1  1
  2 24  1  1
 25 12  1  0
 26 25  1  0
  5 27  1  6
  4 28  1  1
  6 29  1  6
 14 13  1  0
  4  6  1  0
  7 18  1  0
 11 17  1  0
 26 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2335073

   [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-phenylpropanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 492.61

Molecular Weight (Monoisotopic): 492.2512

AlogP: 3.74

#Rotatable Bonds: 6

Polar Surface Area: 100.90

Molecular Species: NEUTRAL

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.61

CX Basic pKa: ┄

CX LogP: 3.99

CX LogD: 3.99

Aromatic Rings: 1

Heavy Atoms: 36

QED Weighted: 0.59

Np Likeness Score: 1.66

References

1. Marquez Ruiz JF, Kedziora K, Pigott M, Keogh B, Windle H, Gavin J, Kelleher DP, Gilmer JF..  (2013)  A nitrophenyl-based prodrug type for colorectal targeting of prednisolone, budesonide and celecoxib.,  23  (6): [PMID:23416011] [10.1016/j.bmcl.2013.01.060]

Source

Source(1):

• Scientific Literature