3-phenyl-N-(4-(5-p-tolyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)phenylsulfonyl)propanamide

ID: ALA2335074

PubChem CID: 71567385

Max Phase: Preclinical

Molecular Formula: C26H22F3N3O3S

Molecular Weight: 513.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)CCc3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C26H22F3N3O3S/c1-18-7-10-20(11-8-18)23-17-24(26(27,28)29)30-32(23)21-12-14-22(15-13-21)36(34,35)31-25(33)16-9-19-5-3-2-4-6-19/h2-8,10-15,17H,9,16H2,1H3,(H,31,33)

Standard InChI Key:  POCGEBMGCNAVLM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   29.2167   -9.8888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6294  -10.5987    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.0378   -9.8864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5107  -11.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5095  -11.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2176  -12.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9272  -11.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9244  -11.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2158  -10.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8015  -12.2431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0538  -11.9116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5065  -12.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9146  -13.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7140  -13.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6916  -12.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3377  -11.7202    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.2308  -13.1315    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.8740  -12.4759    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.4185  -13.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4172  -14.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1241  -14.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8327  -14.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8301  -13.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1226  -13.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5410  -14.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3398  -11.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0460  -10.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7552  -11.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0429   -9.7782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4614  -10.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1706  -10.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1709  -11.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8793  -12.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5864  -11.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5807  -10.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8717  -10.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 19  1  0
 22 25  1  0
  8  2  1  0
  2 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Associated Targets(non-human)

Clostridium perfringens (1165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.54Molecular Weight (Monoisotopic): 513.1334AlogP: 5.30#Rotatable Bonds: 7
Polar Surface Area: 81.06Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.25CX Basic pKa: CX LogP: 6.28CX LogD: 5.34
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.21

References

1. Marquez Ruiz JF, Kedziora K, Pigott M, Keogh B, Windle H, Gavin J, Kelleher DP, Gilmer JF..  (2013)  A nitrophenyl-based prodrug type for colorectal targeting of prednisolone, budesonide and celecoxib.,  23  (6): [PMID:23416011] [10.1016/j.bmcl.2013.01.060]

Source