The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(1-[2.2]Paracyclophane-4-yl-1H-pyrazol-4-ylmethyl)-4-phenyl-piperazine ID: ALA2336892
PubChem CID: 71583848
Max Phase: Preclinical
Molecular Formula: C30H32N4
Molecular Weight: 448.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(N2CCN(Cc3cnn(-c4cc5ccc4CCc4ccc(cc4)CC5)c3)CC2)cc1
Standard InChI: InChI=1S/C30H32N4/c1-2-4-29(5-3-1)33-18-16-32(17-19-33)22-27-21-31-34(23-27)30-20-26-11-10-24-6-8-25(9-7-24)12-14-28(30)15-13-26/h1-9,13,15,20-21,23H,10-12,14,16-19,22H2
Standard InChI Key: VMUIVGHGONOVFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
1.1193 -5.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1182 -6.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8329 -6.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5494 -6.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5464 -5.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8311 -5.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8287 -4.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5419 -3.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8327 -7.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2575 -4.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2578 -5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9727 -5.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6868 -5.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6817 -4.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9663 -3.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3525 -3.8836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1363 -4.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6236 -3.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1383 -2.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3534 -3.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5316 -2.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3563 -2.0595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7873 -2.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6083 -2.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0056 -2.0252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5754 -1.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7480 -1.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8263 -2.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2544 -2.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0784 -2.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4753 -1.9698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0421 -1.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2196 -1.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6613 -7.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
3 9 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
17 18 2 0
16 17 1 0
18 19 1 0
19 20 2 0
20 16 1 0
14 16 1 0
19 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 28 1 0
13 34 1 0
34 9 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.61Molecular Weight (Monoisotopic): 448.2627AlogP: 5.08#Rotatable Bonds: 4Polar Surface Area: 24.30Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.05CX LogP: 6.84CX LogD: 6.68Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.86
References 1. Sanna F, Ortner B, Hübner H, Löber S, Tschammer N, Gmeiner P.. (2013) Discovery of dopamine D₄ receptor antagonists with planar chirality., 21 (7): [PMID:23428965 ] [10.1016/j.bmc.2013.01.065 ] 2. Sanna F, Ortner B, Hübner H, Löber S, Tschammer N, Gmeiner P.. (2013) Discovery of dopamine D₄ receptor antagonists with planar chirality., 21 (7): [PMID:23428965 ] [10.1016/j.bmc.2013.01.065 ]