The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Axistatin 3 ID: ALA2337298
PubChem CID: 71658901
Max Phase: Preclinical
Molecular Formula: C29H47N5O
Molecular Weight: 481.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Axistatin 3 | Axistatin 3|CHEMBL2337298
Canonical SMILES: CNc1ncnc(NC(C)C)c1N(C=O)C/C=C(\C)CC/C=C(\C)CC[C@@]1(C)C(C)=CCC[C@@H]1C
Standard InChI: InChI=1S/C29H47N5O/c1-21(2)33-28-26(27(30-8)31-19-32-28)34(20-35)18-16-23(4)12-9-11-22(3)15-17-29(7)24(5)13-10-14-25(29)6/h11,13,16,19-21,25H,9-10,12,14-15,17-18H2,1-8H3,(H2,30,31,32,33)/b22-11+,23-16+/t25-,29-/m0/s1
Standard InChI Key: JTHIQBCVJBQEBJ-KLNODRGRSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
8.8887 -12.0418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8960 -11.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2021 -10.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4835 -11.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7872 -10.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8096 -9.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1133 -9.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1356 -8.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4393 -8.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8542 -8.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7207 -8.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6984 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9778 -9.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9536 -10.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6480 -11.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3684 -10.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3944 -9.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3902 -9.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1148 -8.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2830 -9.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4612 -12.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1774 -12.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1701 -13.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5928 -12.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5816 -13.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2848 -13.6890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9971 -13.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0018 -12.4652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2980 -12.0541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3021 -11.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0118 -10.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0159 -10.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7175 -11.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8693 -13.6746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8599 -14.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
8 10 1 0
9 11 1 0
12 11 1 1
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
12 19 1 0
13 20 1 6
4 21 1 0
1 22 1 0
22 23 2 0
1 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
25 34 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.73Molecular Weight (Monoisotopic): 481.3781AlogP: 7.14#Rotatable Bonds: 13Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.57CX LogP: 5.99CX LogD: 5.93Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: 1.81
References 1. Pettit GR, Tang Y, Zhang Q, Bourne GT, Arm CA, Leet JE, Knight JC, Pettit RK, Chapuis JC, Doubek DL, Ward FJ, Weber C, Hooper JN.. (2013) Isolation and structures of axistatins 1-3 from the Republic of Palau marine sponge Agelas axifera Hentschel ., 76 (3): [PMID:23410078 ] [10.1021/np300828y ]