Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

N-[4-(4-Fluorobenzyloxymethyl)pyridin-2-yl]-3-phenylpropionamide

ID: ALA2337804

PubChem CID: 71089346

Max Phase: Preclinical

Molecular Formula: C22H21FN2O2

Molecular Weight: 364.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccccc1)Nc1cc(COCc2ccc(F)cc2)ccn1

Standard InChI:  InChI=1S/C22H21FN2O2/c23-20-9-6-18(7-10-20)15-27-16-19-12-13-24-21(14-19)25-22(26)11-8-17-4-2-1-3-5-17/h1-7,9-10,12-14H,8,11,15-16H2,(H,24,25,26)

Standard InChI Key:  PUWUSQHJSRRILK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   19.2934  -16.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2922  -17.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0044  -17.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7182  -17.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7154  -16.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0026  -16.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4257  -16.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1349  -16.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8452  -16.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5586  -16.5854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8421  -15.3540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2688  -16.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9782  -16.5818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6880  -16.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6854  -15.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9671  -14.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2602  -15.3521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9611  -14.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6699  -13.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3847  -14.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0894  -13.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7993  -14.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5077  -13.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5021  -12.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7824  -12.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0769  -12.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2104  -12.4463    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
M  END

Associated Targets(non-human)

Inppl1 Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 364.42Molecular Weight (Monoisotopic): 364.1587AlogP: 4.51#Rotatable Bonds: 8
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.07CX Basic pKa: 3.93CX LogP: 4.61CX LogD: 4.61
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.64Np Likeness Score: -1.06

References

1. Ichihara Y, Fujimura R, Tsuneki H, Wada T, Okamoto K, Gouda H, Hirono S, Sugimoto K, Matsuya Y, Sasaoka T, Toyooka N..  (2013)  Rational design and synthesis of 4-substituted 2-pyridin-2-ylamides with inhibitory effects on SH2 domain-containing inositol 5'-phosphatase 2 (SHIP2).,  62  [PMID:23434638] [10.1016/j.ejmech.2013.01.014]

Source