The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((3-(3-Fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl)-4-phenoxy-benzenesulfonamide ID: ALA2337831
PubChem CID: 71652734
Max Phase: Preclinical
Molecular Formula: C26H26FN3O6S
Molecular Weight: 527.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@@H](CNS(=O)(=O)c2ccc(Oc3ccccc3)cc2)CN1c1ccc(N2CCOCC2)c(F)c1
Standard InChI: InChI=1S/C26H26FN3O6S/c27-24-16-19(6-11-25(24)29-12-14-34-15-13-29)30-18-22(36-26(30)31)17-28-37(32,33)23-9-7-21(8-10-23)35-20-4-2-1-3-5-20/h1-11,16,22,28H,12-15,17-18H2/t22-/m0/s1
Standard InChI Key: OXKHNXQOTCAVFX-QFIPXVFZSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
36.2164 -2.3360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0336 -2.3401 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.6286 -1.6304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0273 -0.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6207 0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8031 0.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3910 -0.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8027 -0.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6190 -0.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8392 -0.2308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3178 -0.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0957 -0.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0979 0.1806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3214 0.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5714 -0.2236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1651 0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3515 0.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9380 -0.2157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3444 -0.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1642 -0.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7554 -1.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7476 -1.9398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0282 -3.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3162 -3.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3080 -4.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0123 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7263 -4.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7310 -3.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0710 1.2118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3946 -1.6441 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.0056 -5.6088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2945 -6.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5925 -5.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8819 -5.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8747 -6.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5840 -7.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2917 -6.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
4 10 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 15 1 0
12 21 1 1
21 22 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 2 0
8 30 1 0
26 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.57Molecular Weight (Monoisotopic): 527.1526AlogP: 3.76#Rotatable Bonds: 8Polar Surface Area: 97.41Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.34CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -1.66
References 1. Kamal A, Swapna P, Shetti RV, Shaik AB, Narasimha Rao MP, Gupta S.. (2013) Synthesis, biological evaluation of new oxazolidino-sulfonamides as potential antimicrobial agents., 62 [PMID:23434639 ] [10.1016/j.ejmech.2013.01.034 ]