The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(5-(N-((3-(3-Fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl)sulfamoyl)-4-methylthiazol-2-yl)acetamide ID: ALA2337832
PubChem CID: 71718913
Max Phase: Preclinical
Molecular Formula: C21H25FN4O6S2
Molecular Weight: 512.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc(C)c(S(=O)(=O)NC[C@H]2CN(c3ccc(N4CCOCC4)c(F)c3)C(=O)O2)s1
Standard InChI: InChI=1S/C21H25FN4O6S2/c1-13-9-19(24-14(2)27)33-20(13)34(29,30)23-11-16-12-26(21(28)32-16)15-3-4-18(17(22)10-15)25-5-7-31-8-6-25/h3-4,9-10,16,23H,5-8,11-12H2,1-2H3,(H,24,27)/t16-/m0/s1
Standard InChI Key: WIRLRKYGCDSQSK-INIZCTEOSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.7050 -10.0209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5222 -10.0250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1172 -9.3153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5160 -7.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1093 -7.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 -7.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8796 -7.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2913 -8.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1076 -8.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3279 -7.9157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8064 -8.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5843 -8.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5865 -7.5105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8100 -7.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0601 -7.9085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6537 -7.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1620 -7.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5740 -7.9006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1714 -8.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6528 -8.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2441 -8.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2362 -9.6247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5168 -10.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5596 -6.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8832 -9.3290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8549 -11.3198 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1027 -12.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9213 -12.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1793 -11.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9578 -11.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6180 -12.7580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8058 -12.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3211 -13.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4784 -11.9185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
4 10 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 15 1 0
12 21 1 1
21 22 1 0
22 2 1 0
2 23 1 0
14 24 2 0
8 25 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 23 2 0
29 30 1 0
27 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.59Molecular Weight (Monoisotopic): 512.1200AlogP: 2.29#Rotatable Bonds: 7Polar Surface Area: 117.28Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.14CX Basic pKa: ┄CX LogP: 2.11CX LogD: 2.10Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: -1.88
References 1. Kamal A, Swapna P, Shetti RV, Shaik AB, Narasimha Rao MP, Gupta S.. (2013) Synthesis, biological evaluation of new oxazolidino-sulfonamides as potential antimicrobial agents., 62 [PMID:23434639 ] [10.1016/j.ejmech.2013.01.034 ]