The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((3-(3-Fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl)quinoline-8-sulfonamide ID: ALA2337833
PubChem CID: 71652736
Max Phase: Preclinical
Molecular Formula: C23H23FN4O5S
Molecular Weight: 486.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@@H](CNS(=O)(=O)c2cccc3cccnc23)CN1c1ccc(N2CCOCC2)c(F)c1
Standard InChI: InChI=1S/C23H23FN4O5S/c24-19-13-17(6-7-20(19)27-9-11-32-12-10-27)28-15-18(33-23(28)29)14-26-34(30,31)21-5-1-3-16-4-2-8-25-22(16)21/h1-8,13,18,26H,9-12,14-15H2/t18-/m0/s1
Standard InChI Key: IGYYSWWEABQOGM-SFHVURJKSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
12.7655 -10.6029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5827 -10.6070 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.1777 -9.8972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5764 -8.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1698 -7.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3521 -7.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9401 -8.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3518 -9.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1681 -9.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3883 -8.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8668 -9.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6447 -8.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6470 -8.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8705 -7.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1205 -8.4904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7142 -7.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9006 -7.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4871 -8.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8935 -9.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7133 -9.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3045 -9.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2967 -10.2066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5773 -11.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8653 -11.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8571 -12.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5614 -13.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6201 -7.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9437 -9.9109 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.2800 -11.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2735 -12.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9750 -13.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6834 -12.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6860 -11.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9839 -11.4353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
4 10 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 15 1 0
12 21 1 1
21 22 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 30 1 0
29 23 1 0
14 27 2 0
8 28 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.53Molecular Weight (Monoisotopic): 486.1373AlogP: 2.51#Rotatable Bonds: 6Polar Surface Area: 101.07Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.51CX Basic pKa: 0.49CX LogP: 2.40CX LogD: 2.40Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -1.98
References 1. Kamal A, Swapna P, Shetti RV, Shaik AB, Narasimha Rao MP, Gupta S.. (2013) Synthesis, biological evaluation of new oxazolidino-sulfonamides as potential antimicrobial agents., 62 [PMID:23434639 ] [10.1016/j.ejmech.2013.01.034 ]