The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3,5-Dichloro-N-((3-(3-fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl)-benzenesulfonamide ID: ALA2337838
PubChem CID: 71652892
Max Phase: Preclinical
Molecular Formula: C20H20Cl2FN3O5S
Molecular Weight: 504.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@@H](CNS(=O)(=O)c2cc(Cl)cc(Cl)c2)CN1c1ccc(N2CCOCC2)c(F)c1
Standard InChI: InChI=1S/C20H20Cl2FN3O5S/c21-13-7-14(22)9-17(8-13)32(28,29)24-11-16-12-26(20(27)31-16)15-1-2-19(18(23)10-15)25-3-5-30-6-4-25/h1-2,7-10,16,24H,3-6,11-12H2/t16-/m0/s1
Standard InChI Key: VUNFHFMYQDUQRO-INIZCTEOSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
13.0420 -17.4912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8592 -17.4953 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.4542 -16.7855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8530 -15.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4463 -14.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6287 -14.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2167 -15.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6283 -16.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4446 -16.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6649 -15.3860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1434 -16.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9213 -15.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9235 -14.9808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1470 -14.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3971 -15.3788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9907 -14.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1771 -14.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7637 -15.3708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1700 -16.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9898 -16.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5811 -16.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5732 -17.0950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8538 -18.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1418 -18.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1336 -19.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8379 -19.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5519 -19.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5566 -18.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8966 -13.9484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2202 -16.7992 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.2571 -19.9536 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.4218 -19.9321 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
4 10 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 15 1 0
12 21 1 1
21 22 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 2 0
8 30 1 0
27 31 1 0
25 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.37Molecular Weight (Monoisotopic): 503.0485AlogP: 3.27#Rotatable Bonds: 6Polar Surface Area: 88.18Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.77CX Basic pKa: ┄CX LogP: 3.45CX LogD: 3.44Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.98
References 1. Kamal A, Swapna P, Shetti RV, Shaik AB, Narasimha Rao MP, Gupta S.. (2013) Synthesis, biological evaluation of new oxazolidino-sulfonamides as potential antimicrobial agents., 62 [PMID:23434639 ] [10.1016/j.ejmech.2013.01.034 ]