The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2,3,4-Trifluoro-N-((3-(3-fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl)benzenesulfonamide ID: ALA2337839
PubChem CID: 71653042
Max Phase: Preclinical
Molecular Formula: C20H19F4N3O5S
Molecular Weight: 489.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@@H](CNS(=O)(=O)c2ccc(F)c(F)c2F)CN1c1ccc(N2CCOCC2)c(F)c1
Standard InChI: InChI=1S/C20H19F4N3O5S/c21-14-2-4-17(19(24)18(14)23)33(29,30)25-10-13-11-27(20(28)32-13)12-1-3-16(15(22)9-12)26-5-7-31-8-6-26/h1-4,9,13,25H,5-8,10-11H2/t13-/m0/s1
Standard InChI Key: DTJQMMFBOSXXAF-ZDUSSCGKSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
20.9622 -18.3909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7794 -18.3951 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.3744 -17.6853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7731 -16.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3665 -15.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5488 -15.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1368 -16.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5484 -16.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3648 -16.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5850 -16.2857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0635 -16.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8414 -16.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8437 -15.8806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0672 -15.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3172 -16.2785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9109 -15.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0973 -15.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6838 -16.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0901 -16.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9099 -16.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5012 -17.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4934 -17.9947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7740 -19.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0620 -19.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0538 -20.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7581 -20.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4720 -20.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4767 -19.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8168 -14.8481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1404 -17.6990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.7513 -21.6637 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1869 -19.2210 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1773 -20.8533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
4 10 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 15 1 0
12 21 1 1
21 22 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 2 0
8 30 1 0
26 31 1 0
28 32 1 0
27 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.45Molecular Weight (Monoisotopic): 489.0982AlogP: 2.38#Rotatable Bonds: 6Polar Surface Area: 88.18Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.54CX Basic pKa: ┄CX LogP: 2.67CX LogD: 2.47Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -2.00
References 1. Kamal A, Swapna P, Shetti RV, Shaik AB, Narasimha Rao MP, Gupta S.. (2013) Synthesis, biological evaluation of new oxazolidino-sulfonamides as potential antimicrobial agents., 62 [PMID:23434639 ] [10.1016/j.ejmech.2013.01.034 ]