Symplostatin 5

ID: ALA2338554

PubChem CID: 71711730

Max Phase: Preclinical

Molecular Formula: C47H64N7NaO15S

Molecular Weight: 1000.14

Molecule Type: Unknown

Names and Identifiers

Synonyms: Symplostatin 5 | Symplostatin 5|CHEMBL2338554

Canonical SMILES:  C/C=C1\NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](COS(=O)(=O)[O-])OC)C(C)C)[C@@H](C)OC(=O)[C@H]([C@H](C)CC)NC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](Cc2ccccc2)N2C(=O)[C@H](CC[C@H]2O)NC1=O.[Na+]

Standard InChI:  InChI=1S/C47H65N7O15S.Na/c1-9-27(5)38-47(63)69-28(6)39(52-43(59)37(26(3)4)50-42(58)35(67-8)25-68-70(64,65)66)44(60)48-31(10-2)40(56)49-32-21-22-36(55)54(45(32)61)34(24-30-19-15-12-16-20-30)46(62)53(7)33(41(57)51-38)23-29-17-13-11-14-18-29;/h10-20,26-28,32-39,55H,9,21-25H2,1-8H3,(H,48,60)(H,49,56)(H,50,58)(H,51,57)(H,52,59)(H,64,65,66);/q;+1/p-1/b31-10-;/t27-,28-,32+,33+,34+,35-,36-,37+,38+,39+;/m1./s1

Standard InChI Key:  KPKJQINJXGFAPS-NBGICTFWSA-M

Molfile:  

     RDKit          2D

 73 75  0  0  0  0  0  0  0  0999 V2000
   10.7723   -3.0904    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
    9.4958   -0.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9125   -1.1917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.3248   -0.4725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3979   -6.1528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5507   -6.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8483   -7.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0665   -8.1692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3836   -8.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0729   -8.7616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7951   -7.3653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0234   -7.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0226   -6.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7941   -5.9575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7255   -5.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4522   -4.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1013   -5.2946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7710   -4.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5013   -5.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5809   -5.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1677   -9.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4781   -9.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9251   -9.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6338   -8.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5068  -10.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5221   -7.4696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0799   -7.0886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3058   -7.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9711   -6.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9714   -6.5527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2283   -4.7949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2540   -3.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9809   -3.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5527   -3.5357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6823   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0067   -2.7556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6565   -4.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4093   -3.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7337   -2.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7593   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4349   -2.8001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4863   -1.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0581   -1.1064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3311   -1.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1875   -1.5854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6158   -1.6299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7093   -3.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5338   -3.9520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0029   -4.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9865   -3.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2968   -5.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3433   -5.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3064   -7.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5945   -7.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6051   -6.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1107   -5.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8261   -6.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8319   -7.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1185   -7.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4971   -6.9319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875   -8.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5708   -8.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6047   -8.3006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8603   -9.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8682  -10.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1553  -10.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1628  -11.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8817  -11.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5945  -11.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5835  -10.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2640   -3.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8868   -5.6947    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2924   -9.0485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  1  0
  6  7  1  0
  9  8  1  0
  7  8  1  0
 11 12  1  0
 12 13  1  0
 15 14  1  0
 15 16  1  0
 16 17  1  0
 13 14  1  0
 18 19  1  0
 19 20  1  0
 17 18  1  0
  5 20  1  0
 10 21  1  0
  9 22  1  0
 21 23  1  0
 22 23  1  0
 10 24  1  0
  9 24  1  0
 21 25  1  1
 24 26  2  0
  7 27  2  0
  6 28  2  0
 28 29  1  0
 20 30  2  0
 19 31  1  6
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 33 36  1  1
 35 37  1  0
 35 38  1  0
 36 39  1  0
 39 40  1  0
 39 41  2  0
 40 42  1  6
 40 43  1  0
 43 44  1  0
 42 45  1  0
 45  3  1  0
  3 46  1  0
 18 47  1  6
 16 48  2  0
 15 49  1  0
 49 50  1  0
 49 51  1  6
 13 52  2  0
 12 53  1  1
 53 54  1  0
 54 55  2  0
 55 56  1  0
 56 57  2  0
 57 58  1  0
 58 59  2  0
 59 54  1  0
 11 60  1  0
 11 61  1  0
 61 62  1  0
 62 10  1  0
 61 63  2  0
 62 64  1  1
 64 65  1  0
 65 66  2  0
 66 67  1  0
 67 68  2  0
 68 69  1  0
 69 70  2  0
 70 65  1  0
 50 71  1  0
 15 72  1  6
  9 73  1  6
M  CHG  2   1   1  46  -1
M  END

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1000.14

Molecular Weight (Monoisotopic): 999.4259

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Salvador LA, Taori K, Biggs JS, Jakoncic J, Ostrov DA, Paul VJ, Luesch H..  (2013)  Potent elastase inhibitors from cyanobacteria: structural basis and mechanisms mediating cytoprotective and anti-inflammatory effects in bronchial epithelial cells.,  56  (3): [PMID:23350733] [10.1021/jm3017305]

2. Chen QY, Luo D, Seabra GM, Luesch H..  (2020)  Ahp-Cyclodepsipeptides as tunable inhibitors of human neutrophil elastase and kallikrein 7: Total synthesis of tutuilamide A, serine protease selectivity profile and comparison with lyngbyastatin 7.,  28  (23.0): [PMID:33002682] [10.1016/j.bmc.2020.115756]

3. Steinmetzer, Torsten T and 11 more authors.  2006-07-13  Secondary amides of sulfonylated 3-amidinophenylalanine. New potent and selective inhibitors of matriptase.  [PMID:16821772]

4. Schepetkin, Igor A IA, Khlebnikov, Andrei I AI and Quinn, Mark T MT.  2007-10-04  N-benzoylpyrazoles are novel small-molecule inhibitors of human neutrophil elastase.  [PMID:17850059]

5. Joossens, Jurgen J and 11 more authors.  2007-12-27  Small, potent, and selective diaryl phosphonate inhibitors for urokinase-type plasminogen activator with in vivo antimetastatic properties.  [PMID:18052026]

6. Wang, Shouming S and 20 more authors.  2010-02-25  Structure based drug design: development of potent and selective factor IXa (FIXa) inhibitors.  [PMID:20121197]

7. Wang, Shouming S and 14 more authors.  2010-02-25  Studies of benzothiophene template as potent factor IXa (FIXa) inhibitors in thrombosis.  [PMID:20121198]

8. Crocetti, Letizia and 8 more authors.  2011-08-01  Design, synthesis and evaluation of N-benzoylindazole derivatives and analogues as inhibitors of human neutrophil elastase.  [PMID:21741848]

9. Crocetti, Letizia and 8 more authors.  2013-08-08  Optimization of N-benzoylindazole derivatives as inhibitors of human neutrophil elastase.  [PMID:23844670]

10. Buckley, Benjamin J BJ and 15 more authors.  2018-09-27  6-Substituted Hexamethylene Amiloride (HMA) Derivatives as Potent and Selective Inhibitors of the Human Urokinase Plasminogen Activator for Use in Cancer.  [PMID:30130401]

11. Islam, Imadul I and 19 more authors.  2018-11-01  Discovery of selective urokinase plasminogen activator (uPA) inhibitors as a potential treatment for multiple sclerosis.  [PMID:30201291]

12. Wang, Dong D and 8 more authors.  2019-02-28  Suppression of Tumor Growth and Metastases by Targeted Intervention in Urokinase Activity with Cyclic Peptides.  [PMID:30707839]

13. Walker, Ann L and 19 more authors.  2019-10-15  Design and development of a series of borocycles as selective, covalent kallikrein 5 inhibitors.  [PMID:31521475]

Source

Source(1):

• Scientific Literature