The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(4-Fluorobutyl)-5-{1-[2-(2,2,2-trifluoroethoxymethyl)pyrrolidinyl]sulfonyl}isatin ID: ALA2348861
PubChem CID: 71583194
Max Phase: Preclinical
Molecular Formula: C19H22F4N2O5S
Molecular Weight: 466.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C(=O)N(CCCCF)c2ccc(S(=O)(=O)N3CCC[C@H]3COCC(F)(F)F)cc21
Standard InChI: InChI=1S/C19H22F4N2O5S/c20-7-1-2-8-24-16-6-5-14(10-15(16)17(26)18(24)27)31(28,29)25-9-3-4-13(25)11-30-12-19(21,22)23/h5-6,10,13H,1-4,7-9,11-12H2/t13-/m0/s1
Standard InChI Key: HOUWXSCEZSJNPK-ZDUSSCGKSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.7153 -12.0309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1280 -12.7408 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.5364 -12.0284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8365 -13.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8353 -13.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5434 -14.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5416 -12.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2502 -13.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2505 -13.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0280 -14.2181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5101 -13.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0287 -12.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3273 -13.5543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2809 -12.1153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4210 -13.1497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6750 -12.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1283 -13.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5371 -14.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3370 -13.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0344 -14.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0142 -15.2007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2976 -15.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2794 -16.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0213 -15.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3102 -15.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3035 -16.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5925 -16.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5858 -17.4752 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5628 -16.8033 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9779 -16.8347 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.2737 -17.2271 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
11 13 2 0
12 14 2 0
4 2 1 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
19 20 1 6
20 21 1 0
21 22 1 0
22 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
23 29 1 0
23 30 1 0
23 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.45Molecular Weight (Monoisotopic): 466.1186AlogP: 2.70#Rotatable Bonds: 9Polar Surface Area: 83.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.02CX LogD: 2.02Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -1.42
References 1. Limpachayaporn P, Schäfers M, Schober O, Kopka K, Haufe G.. (2013) Synthesis of new fluorinated, 2-substituted 5-pyrrolidinylsulfonyl isatin derivatives as caspase-3 and caspase-7 inhibitors: nonradioactive counterparts of putative PET-compatible apoptosis imaging agents., 21 (7): [PMID:23411396 ] [10.1016/j.bmc.2013.01.011 ]