The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
c(Phe(C3)-Gly-Gly-Gly-Gly-Phe(N2) NH2 ID: ALA235515
PubChem CID: 23730956
Max Phase: Preclinical
Molecular Formula: C32H42N8O7
Molecular Weight: 650.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](Cc1ccccc1)N1CCNC(=O)CCCN[C@@H](Cc2ccccc2)C(=O)NCC(=O)NCC(=O)NCC(=O)NCC1=O
Standard InChI: InChI=1S/C32H42N8O7/c33-31(46)25(17-23-10-5-2-6-11-23)40-15-14-35-26(41)12-7-13-34-24(16-22-8-3-1-4-9-22)32(47)39-20-29(44)37-18-27(42)36-19-28(43)38-21-30(40)45/h1-6,8-11,24-25,34H,7,12-21H2,(H2,33,46)(H,35,41)(H,36,42)(H,37,44)(H,38,43)(H,39,47)/t24-,25-/m0/s1
Standard InChI Key: FJAIODVIAPJCOL-DQEYMECFSA-N
Molfile:
RDKit 2D
47 49 0 0 1 0 0 0 0 0999 V2000
10.6656 -0.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9396 -0.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9258 -1.8149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6547 -2.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3696 -3.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6492 -3.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4948 -2.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4948 -3.1144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8131 -3.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4927 -0.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8112 -4.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0900 -4.7566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3560 -4.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0739 0.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7914 0.6169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4963 0.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3551 0.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6427 0.2298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2081 -1.0367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2117 -1.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0113 -2.1325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5020 -1.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0056 -0.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2287 -0.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2357 0.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3859 -0.9659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0663 -0.6046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7781 -1.0397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3270 -1.4476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7808 -1.8747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6385 -4.7419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2112 -3.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2150 -4.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9238 -3.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6401 -3.5171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9313 -4.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9301 -5.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6457 -5.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3592 -5.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3528 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6367 -4.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9558 0.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9631 1.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2516 1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5313 1.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5275 0.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3292 -2.3875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
2 24 1 1
7 8 1 0
24 25 1 0
8 9 1 0
1 26 2 0
10 19 1 0
14 27 2 0
7 20 1 0
10 28 2 0
11 12 1 0
22 29 2 0
9 11 1 0
7 30 2 0
5 13 1 0
13 31 2 0
13 12 1 0
8 32 1 0
14 15 1 0
32 33 1 6
10 16 1 0
32 34 1 0
15 16 1 0
34 35 1 0
17 18 1 0
33 36 1 0
14 17 1 0
36 37 2 0
18 1 1 0
37 38 1 0
38 39 2 0
1 2 1 0
39 40 1 0
2 3 1 0
40 41 2 0
41 36 1 0
3 4 1 0
25 42 2 0
5 6 1 0
42 43 1 0
20 21 1 0
43 44 2 0
21 22 1 0
44 45 1 0
22 23 1 0
45 46 2 0
46 25 1 0
23 19 1 0
34 47 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 650.74Molecular Weight (Monoisotopic): 650.3176AlogP: -2.51#Rotatable Bonds: 6Polar Surface Area: 220.93Molecular Species: NEUTRALHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.95CX Basic pKa: 8.44CX LogP: -3.13CX LogD: -4.20Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.18Np Likeness Score: 0.16
References 1. Hess S, Ovadia O, Shalev DE, Senderovich H, Qadri B, Yehezkel T, Salitra Y, Sheynis T, Jelinek R, Gilon C, Hoffman A.. (2007) Effect of structural and conformation modifications, including backbone cyclization, of hydrophilic hexapeptides on their intestinal permeability and enzymatic stability., 50 (24): [PMID:17983214 ] [10.1021/jm070836d ]