SID124755680

ID: ALA2362674

PubChem CID: 53301507

Max Phase: Preclinical

Molecular Formula: C20H25NO5

Molecular Weight: 359.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2oc3c(c2C(=O)OCCN(C)C)C(O)CCC3)c1

Standard InChI:  InChI=1S/C20H25NO5/c1-21(2)10-11-25-20(23)18-17-15(22)8-5-9-16(17)26-19(18)13-6-4-7-14(12-13)24-3/h4,6-7,12,15,22H,5,8-11H2,1-3H3

Standard InChI Key:  YGPFOCHNQHDEHJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    0.9426    0.6618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0103   -1.6111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5495   -1.4922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7632   -1.9369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7736    1.5780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3383   -3.3452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9426   -0.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1604   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4238    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1604    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2492    0.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5515   -0.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2020   -1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5515    0.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2735   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -0.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2735    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4223    0.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5390   -0.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8917    0.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2702   -2.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0785   -2.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3973    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9846   -3.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8996   -3.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  9  1  0
  1 10  1  0
  2 13  1  0
  2 22  1  0
  3 12  1  0
  4 13  2  0
  5 19  1  0
  5 24  1  0
  6 23  1  0
  6 25  1  0
  6 26  1  0
  7  8  1  0
  7  9  2  0
  7 13  1  0
  8 10  2  0
  8 12  1  0
  9 11  1  0
 10 14  1  0
 11 16  2  0
 11 17  1  0
 12 15  1  0
 14 18  1  0
 15 18  1  0
 16 19  1  0
 17 20  2  0
 19 21  2  0
 20 21  1  0
 22 23  1  0
M  END

Associated Targets(Human)

TARDBP Tchem TAR DNA-binding protein 43 (40113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 359.42Molecular Weight (Monoisotopic): 359.1733AlogP: 3.04#Rotatable Bonds: 6
Polar Surface Area: 72.14Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.82CX Basic pKa: 8.42CX LogP: 2.53CX LogD: 1.47
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.80Np Likeness Score: 0.06

References

1. PubChem BioAssay data set, 

Source

Source(1):