The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103050547 ID: ALA2362893
PubChem CID: 49778346
Max Phase: Preclinical
Molecular Formula: C22H31N7O2
Molecular Weight: 425.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCNc1ncnc2c1ncn2[C@H]1CN(CCc2ccccc2)C[C@@H](CO)O1
Standard InChI: InChI=1S/C22H31N7O2/c1-27(2)11-9-23-21-20-22(25-15-24-21)29(16-26-20)19-13-28(12-18(14-30)31-19)10-8-17-6-4-3-5-7-17/h3-7,15-16,18-19,30H,8-14H2,1-2H3,(H,23,24,25)/t18-,19+/m0/s1
Standard InChI Key: WCWBSFPCGODGID-RBUKOAKNSA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
3.6753 -2.8147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2030 -5.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8565 -5.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 3.0138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5842 6.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2781 -3.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2537 -4.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3443 -5.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9491 -6.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7419 -4.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5297 -7.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6223 -8.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2878 5.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2007 -10.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8655 -8.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2913 -11.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7749 -9.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1965 -11.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5796 7.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6259 5.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 1 0
1 16 1 0
2 20 1 0
3 10 1 0
12 3 1 6
3 14 1 0
4 11 1 0
4 14 2 0
5 10 1 0
5 17 2 0
6 15 1 0
6 18 1 0
6 19 1 0
7 13 2 0
7 17 1 0
8 13 1 0
8 21 1 0
9 24 1 0
9 30 1 0
9 31 1 0
10 11 2 0
11 13 1 0
12 15 1 0
16 18 1 0
16 20 1 6
19 22 1 0
21 24 1 0
22 23 1 0
23 25 2 0
23 26 1 0
25 27 1 0
26 28 2 0
27 29 2 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.54Molecular Weight (Monoisotopic): 425.2539AlogP: 1.23#Rotatable Bonds: 9Polar Surface Area: 91.57Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.68CX LogP: 1.52CX LogD: 0.11Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -0.57
References 1. PubChem BioAssay data set,