SID99494573

ID: ALA2362898

PubChem CID: 46948048

Max Phase: Preclinical

Molecular Formula: C22H24N2O5S

Molecular Weight: 428.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)NC(=O)C2(C)CCN2C(=O)C2(c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C22H24N2O5S/c1-21(19(25)23-30(27,28)18-10-8-17(29-2)9-11-18)14-15-24(21)20(26)22(12-13-22)16-6-4-3-5-7-16/h3-11H,12-15H2,1-2H3,(H,23,25)

Standard InChI Key:  NXAQSQUQCXQAKG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -1.4294    0.8252    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0659    4.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7162    1.7332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0008    0.4951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0011    1.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4285   -0.8267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9767    3.6602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4299    1.6507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0128    5.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1453    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4061    4.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3829    5.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3608    4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4446    5.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1447    2.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3928    2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1797    3.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7170    3.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2693    5.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0512    6.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7007    6.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4826    7.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3073    7.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276   -1.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  5  2  0
  1  8  1  0
  1 21  1  0
  2 11  2  0
  3 15  2  0
  6 27  1  0
  6 30  1  0
  7 10  1  0
  7 11  1  0
  7 17  1  0
  8 15  1  0
  9 11  1  0
  9 12  1  0
  9 13  1  0
  9 14  1  0
 10 15  1  0
 10 16  1  0
 10 18  1  0
 12 13  1  0
 14 19  2  0
 14 20  1  0
 16 17  1  0
 19 22  1  0
 20 23  2  0
 21 24  2  0
 21 25  1  0
 22 26  2  0
 23 26  1  0
 24 28  1  0
 25 29  2  0
 27 28  2  0
 27 29  1  0
M  END

Associated Targets(Human)

TARDBP Tchem TAR DNA-binding protein 43 (40113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.51Molecular Weight (Monoisotopic): 428.1406AlogP: 2.22#Rotatable Bonds: 6
Polar Surface Area: 92.78Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.00CX Basic pKa: CX LogP: 2.53CX LogD: 1.59
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.76Np Likeness Score: -0.69

References

1. PubChem BioAssay data set, 

Source

Source(1):