The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID99494573 ID: ALA2362898
PubChem CID: 46948048
Max Phase: Preclinical
Molecular Formula: C22H24N2O5S
Molecular Weight: 428.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)NC(=O)C2(C)CCN2C(=O)C2(c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C22H24N2O5S/c1-21(19(25)23-30(27,28)18-10-8-17(29-2)9-11-18)14-15-24(21)20(26)22(12-13-22)16-6-4-3-5-7-16/h3-11H,12-15H2,1-2H3,(H,23,25)
Standard InChI Key: NXAQSQUQCXQAKG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-1.4294 0.8252 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.0659 4.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7162 1.7332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0008 0.4951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0011 1.1550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4285 -0.8267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9767 3.6602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4299 1.6507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0128 5.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4061 4.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3829 5.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3608 4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4446 5.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1447 2.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3928 2.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1797 3.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7170 3.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2693 5.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0512 6.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7007 6.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4826 7.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3073 7.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -1.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 8 1 0
1 21 1 0
2 11 2 0
3 15 2 0
6 27 1 0
6 30 1 0
7 10 1 0
7 11 1 0
7 17 1 0
8 15 1 0
9 11 1 0
9 12 1 0
9 13 1 0
9 14 1 0
10 15 1 0
10 16 1 0
10 18 1 0
12 13 1 0
14 19 2 0
14 20 1 0
16 17 1 0
19 22 1 0
20 23 2 0
21 24 2 0
21 25 1 0
22 26 2 0
23 26 1 0
24 28 1 0
25 29 2 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.51Molecular Weight (Monoisotopic): 428.1406AlogP: 2.22#Rotatable Bonds: 6Polar Surface Area: 92.78Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.00CX Basic pKa: ┄CX LogP: 2.53CX LogD: 1.59Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.76Np Likeness Score: -0.69
References 1. PubChem BioAssay data set,