The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID22410381 ID: ALA2362948
PubChem CID: 4884051
Max Phase: Preclinical
Molecular Formula: C21H23N3O4S
Molecular Weight: 413.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)Nc1cccc2ccccc12
Standard InChI: InChI=1S/C21H23N3O4S/c1-24(2)29(26,27)16-11-12-20(28-3)19(13-16)22-14-21(25)23-18-10-6-8-15-7-4-5-9-17(15)18/h4-13,22H,14H2,1-3H3,(H,23,25)
Standard InChI Key: JGBNBZFSIWCXGM-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-1.2552 10.4974 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.2197 9.8909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2121 11.0907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4720 7.5301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2453 11.9982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5593 9.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5682 8.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1663 8.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8539 10.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1574 9.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2026 12.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2808 12.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5068 8.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 6 1 0
1 9 1 0
4 12 1 0
4 29 1 0
5 18 2 0
6 25 1 0
6 26 1 0
7 10 1 0
7 19 1 0
8 16 1 0
8 18 1 0
9 11 1 0
9 13 2 0
10 11 2 0
10 12 1 0
12 15 2 0
13 15 1 0
14 16 1 0
14 17 1 0
14 21 2 0
16 20 2 0
17 22 1 0
17 23 2 0
18 19 1 0
20 24 1 0
21 27 1 0
22 24 2 0
23 28 1 0
27 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.50Molecular Weight (Monoisotopic): 413.1409AlogP: 3.15#Rotatable Bonds: 7Polar Surface Area: 87.74Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.69CX Basic pKa: 1.50CX LogP: 2.24CX LogD: 2.24Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.62Np Likeness Score: -1.85
References 1. PubChem BioAssay data set,