The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Carbonic acid 2-methoxy-3-octadecyloxy-propyl ester 2,3,4,6-tetrahydroxy-5-hydroxymethyl-cyclohexyl ester ID: ALA2367874
PubChem CID: 73348313
Max Phase: Preclinical
Molecular Formula: C30H58O10
Molecular Weight: 578.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCCOC[C@H](COC(=O)O[C@@H]1[C@H](O)[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OC
Standard InChI: InChI=1S/C30H58O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-38-21-23(37-2)22-39-30(36)40-29-26(33)24(20-31)25(32)27(34)28(29)35/h23-29,31-35H,3-22H2,1-2H3/t23-,24-,25-,26-,27+,28+,29-/m1/s1
Standard InChI Key: ARSOCJAZLCXHOY-FPSDISKKSA-N
Molfile:
RDKit 2D
40 40 0 0 1 0 0 0 0 0999 V2000
0.9324 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2179 -12.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2179 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4965 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9324 -11.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4965 -11.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3614 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6469 -10.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3614 -11.8748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0758 -10.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2179 -9.8123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2110 -10.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6469 -12.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2110 -12.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2179 -13.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5048 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7903 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5048 -9.8123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4965 -13.5248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9337 -10.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2192 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6482 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2192 -9.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3626 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0797 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3652 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6508 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0771 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7916 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5061 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2205 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9350 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6495 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3639 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0784 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7929 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5074 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2218 -11.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9363 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7942 -10.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 3 1 0
5 1 1 0
6 2 1 0
7 8 1 0
1 8 1 6
9 7 2 0
10 7 1 0
3 11 1 6
4 12 1 6
5 13 1 6
6 14 1 1
2 15 1 6
16 17 1 0
17 10 1 0
16 18 1 6
19 15 1 0
20 21 1 0
21 16 1 0
22 20 1 0
23 18 1 0
24 22 1 0
25 26 1 0
26 27 1 0
27 39 1 0
28 24 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
38 37 1 0
39 38 1 0
40 25 1 0
4 6 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.78Molecular Weight (Monoisotopic): 578.4030AlogP: 3.87#Rotatable Bonds: 24Polar Surface Area: 155.14Molecular Species: NEUTRALHBA: 10HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.68CX Basic pKa: ┄CX LogP: 4.79CX LogD: 4.79Aromatic Rings: ┄Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: 0.99
References 1. Hu Y, Qiao L, Wang S, Rong SB, Meuillet EJ, Berggren M, Gallegos A, Powis G, Kozikowski AP.. (2000) 3-(Hydroxymethyl)-bearing phosphatidylinositol ether lipid analogues and carbonate surrogates block PI3-K, Akt, and cancer cell growth., 43 (16): [PMID:10956212 ] [10.1021/jm000117y ]