The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-O-methyllateriflorone ID: ALA2368465
PubChem CID: 73355967
Max Phase: Preclinical
Molecular Formula: C34H40O9
Molecular Weight: 592.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@]12C=C3C(=O)O[C@]4(O[C@]35[C@@H](C1)C(C)(C)OC5(CC=C(C)C)C2=O)C(=O)C1=C(C=CC(C)(C)O1)C(=O)C4CC=C(C)C
Standard InChI: InChI=1S/C34H40O9/c1-18(2)10-11-21-24(35)20-13-14-29(5,6)40-25(20)26(36)34(21)41-27(37)22-16-31(39-9)17-23-30(7,8)42-32(28(31)38,15-12-19(3)4)33(22,23)43-34/h10,12-14,16,21,23H,11,15,17H2,1-9H3/t21?,23-,31-,32?,33-,34+/m0/s1
Standard InChI Key: HPXYRFJVBIOJKL-XVUCNPDJSA-N
Molfile:
RDKit 2D
44 49 0 0 1 0 0 0 0 0999 V2000
3.6417 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1292 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0625 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -2.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 -1.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -1.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3292 -3.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7667 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 -2.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -4.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7750 -3.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -0.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -4.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -2.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -1.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 -3.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6542 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4542 -3.9250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7792 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 0.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4000 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0542 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9792 -4.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -5.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2000 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0333 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0875 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 1.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7667 0.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7667 -4.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 -4.9416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 12 1 6
2 3 1 0
4 2 1 0
5 6 1 0
6 1 1 0
7 17 1 0
1 8 1 6
9 2 1 0
10 1 1 0
11 19 1 0
1 12 1 0
13 8 1 0
14 3 1 0
15 3 1 0
16 4 2 0
17 10 1 0
9 18 1 0
19 9 1 0
20 7 1 0
21 5 1 0
22 3 1 0
23 10 1 0
24 20 2 0
25 21 1 0
26 6 2 0
27 22 1 0
28 23 1 0
29 14 2 0
30 13 2 0
31 17 2 0
32 27 2 0
33 28 2 0
11 34 1 6
35 18 1 0
36 18 1 0
37 25 1 0
38 25 1 0
39 32 1 0
40 32 1 0
41 33 1 0
42 33 1 0
43 34 1 0
4 13 1 0
5 7 2 0
15 18 1 0
16 11 1 0
11 14 1 0
25 24 1 0
9 44 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.69Molecular Weight (Monoisotopic): 592.2672AlogP: 4.56#Rotatable Bonds: 5Polar Surface Area: 114.43Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.84CX LogD: 5.84Aromatic Rings: ┄Heavy Atoms: 43QED Weighted: 0.33Np Likeness Score: 2.77
References 1. Nicolaou KC.. (2005) Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry., 48 (18): [PMID:16134928 ] [10.1021/jm050524f ] 2. Nicolaou KC.. (2005) Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry., 48 (18): [PMID:16134928 ] [10.1021/jm050524f ]