Uridine-5'-diphosphogalactose derivative

ID: ALA2368470

PubChem CID: 73346845

Max Phase: Preclinical

Molecular Formula: C23H33N3O8S

Molecular Weight: 511.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H]1[C@H](OCCCNS(=O)(=O)c2cccc3c(N(C)C)cccc23)O[C@@H](CO)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C23H33N3O8S/c1-14(28)25-20-22(30)21(29)18(13-27)34-23(20)33-12-6-11-24-35(31,32)19-10-5-7-15-16(19)8-4-9-17(15)26(2)3/h4-5,7-10,18,20-24,27,29-30H,6,11-13H2,1-3H3,(H,25,28)/t18-,20-,21-,22+,23+/m0/s1

Standard InChI Key:  VBYQWWMCAKMOQN-YRFMLNNJSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    6.6369   -1.5744    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4935    2.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790    3.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4935    2.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790    1.7256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0645    2.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6369   -2.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0645    2.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3513   -2.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3513   -3.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079    3.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0658   -4.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8119   -1.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4619   -1.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079    4.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6369   -0.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0658   -4.8744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224    4.6131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790    4.2006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500    3.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079    1.7256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500    1.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0658   -2.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6369   -4.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224   -2.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7803   -3.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224    0.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500    0.9006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224   -3.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7803   -2.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224   -0.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4935    4.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7803   -5.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3513   -5.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2079    0.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  2  1  0
  4 21  1  6
  5  4  1  0
  6  8  1  0
  7  1  1  0
  8  5  1  0
  9  7  1  0
 10  9  2  0
  2 11  1  6
 12 10  1  0
 13  1  2  0
 14  1  2  0
 15 11  1  0
 16  1  1  0
 17 12  1  0
 18 15  2  0
  3 19  1  6
  6 20  1  6
 21 35  1  0
  8 22  1  1
 23  9  1  0
 24 29  2  0
 25  7  2  0
 26 30  1  0
 27 31  1  0
 28 22  1  0
 29 25  1  0
 30 23  2  0
 31 16  1  0
 32 15  1  0
 33 17  1  0
 34 17  1  0
 35 27  1  0
 24 10  1  0
 26 12  2  0
  6  3  1  0
M  END

Associated Targets(Human)

B4GALT1 Tbio Beta-1,4-galactosyltransferase 1 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.60Molecular Weight (Monoisotopic): 511.1988AlogP: -0.47#Rotatable Bonds: 10
Polar Surface Area: 157.66Molecular Species: NEUTRALHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.91CX Basic pKa: 4.63CX LogP: -0.79CX LogD: -0.79
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.06

References

1. Takaya K, Nagahori N, Kurogochi M, Furuike T, Miura N, Monde K, Lee YC, Nishimura S..  (2005)  Rational design, synthesis, and characterization of novel inhibitors for human beta1,4-galactosyltransferase.,  48  (19): [PMID:16162007] [10.1021/jm0504297]

Source