benzyl (S)-1-((S)-4-fluoro-3-oxo-1-phenylbutan-2-ylamino)-1-oxo-3-phenylpropan-2-ylcarbamate

ID: ALA2368566

Cas Number: 105608-85-3

PubChem CID: 11705307

Max Phase: Preclinical

Molecular Formula: C27H27FN2O4

Molecular Weight: 462.52

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)CF)OCc1ccccc1

Standard InChI:  InChI=1S/C27H27FN2O4/c28-18-25(31)23(16-20-10-4-1-5-11-20)29-26(32)24(17-21-12-6-2-7-13-21)30-27(33)34-19-22-14-8-3-9-15-22/h1-15,23-24H,16-19H2,(H,29,32)(H,30,33)/t23-,24-/m0/s1

Standard InChI Key:  CAILNONEKASNSH-ZEQRLZLVSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -2.7306  -24.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7318  -25.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0169  -26.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3005  -25.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3034  -24.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4452  -24.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4454  -23.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7310  -23.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7312  -22.3458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0164  -23.5831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0162  -24.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3021  -23.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5875  -23.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3022  -22.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5873  -24.4078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1269  -23.1701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8415  -23.5824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5558  -23.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8417  -24.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5562  -24.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2704  -23.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5556  -22.3448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9848  -23.1694    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5879  -21.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1269  -22.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8408  -21.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8410  -21.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1214  -20.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5895  -21.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5516  -25.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2653  -26.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9807  -25.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9778  -24.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2635  -24.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 16  1  6
  7  8  1  0
 17 18  1  0
 17 19  1  0
  8  9  2  0
 19 20  1  0
  4  5  1  0
 18 21  1  0
  8 10  1  0
 18 22  2  0
  5 11  2  0
 21 23  1  0
 11  1  1  0
 14 24  1  0
 12 10  1  1
 24 25  2  0
  2  3  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
  1  6  1  0
 27 28  1  0
 12 14  1  0
 28 29  2  0
 29 24  1  0
  1  2  2  0
 20 30  2  0
 13 15  2  0
 30 31  1  0
  6  7  1  0
 31 32  2  0
 13 16  1  0
 32 33  1  0
  3  4  2  0
 33 34  2  0
 34 20  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2368566

   benzyl N-[(2S)-1-[[(2S)-4-fluoro-3-oxo-1-phenylbutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 462.52

Molecular Weight (Monoisotopic): 462.1955

AlogP: 3.79

#Rotatable Bonds: 11

Polar Surface Area: 84.50

Molecular Species: NEUTRAL

HBA: 4

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.60

CX Basic pKa: ┄

CX LogP: 4.76

CX LogD: 4.76

Aromatic Rings: 3

Heavy Atoms: 34

QED Weighted: 0.45

Np Likeness Score: -0.12

References

1. Kang DH, Jun KY, Lee JP, Pak CS, Na Y, Kwon Y..  (2009)  Identification of 3-acetyl-2-aminoquinolin-4-one as a novel, nonpeptidic scaffold for specific calpain inhibitory activity.,  52  (9): [PMID:19419206] [10.1021/jm8014734]

2. Kim SH, Lee E, Baek KH, Kwon HB, Woo H, Lee ES, Kwon Y, Na Y..  (2013)  Chalcones, inhibitors for topoisomerase I and cathepsin B and L, as potential anti-cancer agents.,  23  (11): [PMID:23608763] [10.1016/j.bmcl.2013.03.106]

3. Jeon KH,Lee E,Jun KY,Eom JE,Kwak SY,Na Y,Kwon Y.  (2016)  Neuroprotective effect of synthetic chalcone derivatives as competitive dual inhibitors against μ-calpain and cathepsin B through the downregulation of tau phosphorylation and insoluble Aβ peptide formation.,  121  [PMID:27318120] [10.1016/j.ejmech.2016.06.008]

4. Altıntop MD, Özdemir A, Temel HE, Demir Cevizlidere B, Sever B, Kaplancıklı ZA, Akalın Çiftçi G..  (2022)  Design, synthesis and biological evaluation of a new series of arylidene indanones as small molecules for targeted therapy of non-small cell lung carcinoma and prostate cancer.,  244  [PMID:36270087] [10.1016/j.ejmech.2022.114851]

Source

Source(1):

• Scientific Literature