The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-[2-(4-hydroxy-benzyl)-3,7,14-trioxo-1,4,8triaza-cyclotetradec-13-yl]-3-phenyl-propionamide ID: ALA2371260
PubChem CID: 11081770
Max Phase: Preclinical
Molecular Formula: C27H35N5O5
Molecular Weight: 509.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](Cc1ccccc1)C(=O)N[C@H]1CCCCNC(=O)CCNC(=O)[C@H](Cc2ccc(O)cc2)NC1=O
Standard InChI: InChI=1S/C27H35N5O5/c28-21(16-18-6-2-1-3-7-18)25(35)31-22-8-4-5-14-29-24(34)13-15-30-26(36)23(32-27(22)37)17-19-9-11-20(33)12-10-19/h1-3,6-7,9-12,21-23,33H,4-5,8,13-17,28H2,(H,29,34)(H,30,36)(H,31,35)(H,32,37)/t21-,22-,23-/m0/s1
Standard InChI Key: WTKDWDKXOKQFSN-VABKMULXSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
4.3879 -1.4691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7367 -1.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8528 -2.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1902 -1.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -1.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5815 -2.5506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6438 -4.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3839 -2.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6515 -1.9924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1551 -2.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9926 -4.8258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0971 -1.4691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1980 -0.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8180 -3.7560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0043 -3.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3608 -0.7249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2911 -4.8181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4186 -2.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0043 -2.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7717 0.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1784 -1.6629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9229 1.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2791 -2.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5624 -0.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5507 0.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1282 1.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1438 0.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5004 1.8799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1902 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3839 -3.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2519 -1.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0078 -2.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3879 -4.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7367 -4.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7171 -2.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9496 -1.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6822 -1.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 1 1 0
5 4 1 0
8 6 1 6
7 15 1 0
8 2 1 0
9 5 1 0
10 3 1 0
11 7 1 0
12 2 2 0
4 13 1 1
14 3 2 0
15 19 1 0
16 5 2 0
17 7 2 0
10 18 1 0
19 9 1 0
20 13 1 0
10 21 1 6
22 26 1 0
23 18 1 0
24 20 2 0
25 20 1 0
26 25 2 0
27 24 1 0
28 22 1 0
29 33 1 0
8 30 1 0
31 23 1 0
32 23 2 0
33 34 1 0
34 30 1 0
35 32 1 0
36 31 2 0
37 35 2 0
22 27 2 0
11 29 1 0
37 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.61Molecular Weight (Monoisotopic): 509.2638AlogP: 0.28#Rotatable Bonds: 6Polar Surface Area: 162.65Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.49CX Basic pKa: 7.70CX LogP: 0.26CX LogD: -0.08Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 0.60
References 1. Haramura M, Okamachi A, Tsuzuki K, Yogo K, Ikuta M, Kozono T, Takanashi H, Murayama E.. (2002) Design and synthesis of motilin antagonists derived from the [1-4] fragment of porcine motilin., 45 (3): [PMID:11806718 ] [10.1021/jm010332u ]