2-Amino-N-[2-(4-hydroxy-benzyl)-3,7,14-trioxo-1,4,8triaza-cyclotetradec-13-yl]-3-phenyl-propionamide

ID: ALA2371260

PubChem CID: 11081770

Max Phase: Preclinical

Molecular Formula: C27H35N5O5

Molecular Weight: 509.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H](Cc1ccccc1)C(=O)N[C@H]1CCCCNC(=O)CCNC(=O)[C@H](Cc2ccc(O)cc2)NC1=O

Standard InChI:  InChI=1S/C27H35N5O5/c28-21(16-18-6-2-1-3-7-18)25(35)31-22-8-4-5-14-29-24(34)13-15-30-26(36)23(32-27(22)37)17-19-9-11-20(33)12-10-19/h1-3,6-7,9-12,21-23,33H,4-5,8,13-17,28H2,(H,29,34)(H,30,36)(H,31,35)(H,32,37)/t21-,22-,23-/m0/s1

Standard InChI Key:  WTKDWDKXOKQFSN-VABKMULXSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    4.3879   -1.4691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7367   -1.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8528   -2.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1902   -1.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -1.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5815   -2.5506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6438   -4.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3839   -2.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6515   -1.9924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1551   -2.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9926   -4.8258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0971   -1.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1980   -0.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8180   -3.7560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0043   -3.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3608   -0.7249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2911   -4.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4186   -2.8762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0043   -2.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7717    0.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1784   -1.6629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9229    1.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2791   -2.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5624   -0.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5507    0.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1282    1.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1438    0.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5004    1.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1902   -5.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3839   -3.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2519   -1.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0078   -2.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3879   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7367   -4.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7171   -2.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9496   -1.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6822   -1.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  6  1  0
  4  1  1  0
  5  4  1  0
  8  6  1  6
  7 15  1  0
  8  2  1  0
  9  5  1  0
 10  3  1  0
 11  7  1  0
 12  2  2  0
  4 13  1  1
 14  3  2  0
 15 19  1  0
 16  5  2  0
 17  7  2  0
 10 18  1  0
 19  9  1  0
 20 13  1  0
 10 21  1  6
 22 26  1  0
 23 18  1  0
 24 20  2  0
 25 20  1  0
 26 25  2  0
 27 24  1  0
 28 22  1  0
 29 33  1  0
  8 30  1  0
 31 23  1  0
 32 23  2  0
 33 34  1  0
 34 30  1  0
 35 32  1  0
 36 31  2  0
 37 35  2  0
 22 27  2  0
 11 29  1  0
 37 36  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

MLNR Motilin receptor (232 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oryctolagus cuniculus (11301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.61Molecular Weight (Monoisotopic): 509.2638AlogP: 0.28#Rotatable Bonds: 6
Polar Surface Area: 162.65Molecular Species: NEUTRALHBA: 6HBD: 6
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.49CX Basic pKa: 7.70CX LogP: 0.26CX LogD: -0.08
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 0.60

References

1. Haramura M, Okamachi A, Tsuzuki K, Yogo K, Ikuta M, Kozono T, Takanashi H, Murayama E..  (2002)  Design and synthesis of motilin antagonists derived from the [1-4] fragment of porcine motilin.,  45  (3): [PMID:11806718] [10.1021/jm010332u]

Source