The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-pentanedioic acid 5-amide 1-({1-[1-({[1-(1-carbamoyl-3-methylsulfanyl-propylcarbamoyl)-3-methyl-butylcarbamoyl]-methyl}-carbamoyl)-2-phenyl-ethylcarbamoyl]-2-phenyl-ethyl}-amide) ID: ALA2372339
PubChem CID: 73356290
Max Phase: Preclinical
Molecular Formula: C36H52N8O7S
Molecular Weight: 740.93
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCC(N)=O)C(N)=O
Standard InChI: InChI=1S/C36H52N8O7S/c1-22(2)18-27(35(50)42-26(32(39)47)16-17-52-3)41-31(46)21-40-34(49)28(19-23-10-6-4-7-11-23)44-36(51)29(20-24-12-8-5-9-13-24)43-33(48)25(37)14-15-30(38)45/h4-13,22,25-29H,14-21,37H2,1-3H3,(H2,38,45)(H2,39,47)(H,40,49)(H,41,46)(H,42,50)(H,43,48)(H,44,51)/t25-,26+,27-,28-,29-/m0/s1
Standard InChI Key: JRJICHIAKDIPMB-YFXPIYGVSA-N
Molfile:
RDKit 2D
52 53 0 0 0 0 0 0 0 0999 V2000
6.6934 -10.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7154 -8.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8483 -9.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8217 -11.8091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2067 -9.6606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5871 -7.8825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4102 -12.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3350 -10.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1801 -12.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4853 -8.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1755 -8.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6137 -9.8088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3836 -10.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2819 -11.2164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8171 -7.5861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8749 -6.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9235 -10.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0738 -9.2161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6182 -9.4383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1050 -10.7719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3084 -13.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7200 -8.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7686 -12.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4056 -7.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1270 -8.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0252 -9.5865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7466 -5.6599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5119 -10.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3616 -7.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3038 -8.9197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2333 -6.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6448 -6.7712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6888 -6.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9501 -8.0307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2333 -11.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6668 -13.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7906 -5.6599 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9986 -7.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9189 -6.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4322 -5.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8969 -13.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -12.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0032 -11.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7951 -14.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2287 -7.3639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6402 -7.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7200 -12.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1315 -12.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1535 -14.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2553 -13.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4899 -13.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3836 -14.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 10 1 0
3 5 1 0
4 1 1 0
5 8 1 0
6 2 1 0
7 9 1 0
8 1 1 0
9 4 1 0
10 12 1 0
11 15 1 0
12 13 1 0
13 28 1 0
14 7 1 0
15 6 1 0
16 31 1 0
17 1 2 0
18 2 2 0
19 3 2 0
8 20 1 1
9 21 1 1
22 3 1 0
23 7 2 0
24 11 2 0
10 25 1 6
26 13 2 0
27 16 2 0
28 14 1 0
22 29 1 1
30 11 1 0
31 29 1 0
32 16 1 0
15 33 1 1
34 22 1 0
35 20 1 0
36 21 1 0
37 39 1 0
38 25 1 0
39 33 1 0
40 37 1 0
41 36 2 0
42 35 2 0
43 35 1 0
44 36 1 0
45 38 1 0
46 38 1 0
47 42 1 0
48 43 2 0
49 44 2 0
50 41 1 0
51 48 1 0
52 49 1 0
47 51 2 0
50 52 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 740.93Molecular Weight (Monoisotopic): 740.3680AlogP: -0.60#Rotatable Bonds: 23Polar Surface Area: 257.70Molecular Species: NEUTRALHBA: 9HBD: 8#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.76CX Basic pKa: 7.92CX LogP: -0.58CX LogD: -1.22Aromatic Rings: 2Heavy Atoms: 52QED Weighted: 0.07Np Likeness Score: -0.24
References 1. Jacobson KA, Lipkowski AW, Moody TW, Padgett W, Pijl E, Kirk KL, Daly JW.. (1987) Binary drugs: conjugates of purines and a peptide that bind to both adenosine and substance P receptors., 30 (8): [PMID:2441057 ] [10.1021/jm00391a046 ]