The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-{2-[3-Carboxy-1-(carboxymethyl-carbamoyl)-propylcarbamoyl]-pyrrolidin-1-yl}-4-{2-[(9,10-dioxo-9,10-dihydro-phenanthrene-2-carbonyl)-amino]-acetylamino}-5-oxo-pentanoic acid ID: ALA2372892
PubChem CID: 10818644
Max Phase: Preclinical
Molecular Formula: C34H35N5O13
Molecular Weight: 721.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)c1ccc2c(c1)C(=O)C(=O)c1ccccc1-2)C(=O)NCC(=O)O
Standard InChI: InChI=1S/C34H35N5O13/c40-25(15-35-31(49)17-7-8-19-18-4-1-2-5-20(18)29(47)30(48)21(19)14-17)37-23(10-12-27(43)44)34(52)39-13-3-6-24(39)33(51)38-22(9-11-26(41)42)32(50)36-16-28(45)46/h1-2,4-5,7-8,14,22-24H,3,6,9-13,15-16H2,(H,35,49)(H,36,50)(H,37,40)(H,38,51)(H,41,42)(H,43,44)(H,45,46)/t22-,23-,24-/m0/s1
Standard InChI Key: VBKWFVJBVAGRSM-HJOGWXRNSA-N
Molfile:
RDKit 2D
52 55 0 0 0 0 0 0 0 0999 V2000
3.5649 -3.5482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5690 -3.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2811 -3.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9974 -3.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8527 -3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5940 -4.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3020 -2.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0182 -4.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3311 -4.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2728 -3.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8568 -3.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0266 -1.9115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1406 -3.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4368 -3.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4509 -1.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1572 -3.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4160 -3.1526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8943 -4.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7762 -2.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6996 -3.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7329 -3.5357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1880 -2.1614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6123 -2.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6633 -4.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4493 -5.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2436 -2.2114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7054 -3.0110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8402 -2.3155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6023 -1.8615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -4.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4201 -2.2863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4259 -0.9370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1489 -4.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6871 -4.3770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6623 -2.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9886 -4.7268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1656 -6.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8470 -3.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0083 -3.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8752 -1.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7648 -4.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4410 -4.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5883 -3.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4087 -4.6018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7371 -6.0511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2994 -1.6159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7553 -4.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3436 -5.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9017 -3.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5976 -4.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0682 -5.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7678 -5.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 1 0
3 2 1 0
4 3 1 0
5 1 1 0
6 18 1 0
10 7 1 6
8 9 2 0
9 6 1 0
10 1 1 0
11 16 2 0
12 7 1 0
13 5 1 0
14 21 1 0
15 19 1 0
16 14 1 0
17 13 1 0
18 30 2 0
19 12 1 0
20 17 1 0
21 39 1 0
22 15 1 0
23 40 1 0
24 43 1 0
25 42 1 0
26 3 2 0
27 4 2 0
28 5 2 0
29 7 2 0
30 16 1 0
31 14 2 0
32 15 2 0
13 33 1 6
34 20 2 0
35 23 2 0
36 24 2 0
37 25 2 0
19 38 1 6
39 20 1 0
40 22 1 0
41 1 1 0
42 33 1 0
43 38 1 0
44 24 1 0
45 25 1 0
46 23 1 0
47 8 1 0
48 9 1 0
49 10 1 0
50 41 1 0
51 48 2 0
52 51 1 0
50 49 1 0
2 6 2 0
4 8 1 0
47 52 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 721.68Molecular Weight (Monoisotopic): 721.2231AlogP: -0.65#Rotatable Bonds: 16Polar Surface Area: 282.75Molecular Species: ACIDHBA: 10HBD: 7#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.25CX Basic pKa: ┄CX LogP: -1.68CX LogD: -11.37Aromatic Rings: 2Heavy Atoms: 52QED Weighted: 0.11Np Likeness Score: -0.30
References 1. Urbanek RA, Suchard SJ, Steelman GB, Knappenberger KS, Sygowski LA, Veale CA, Chapdelaine MJ.. (2001) Potent reversible inhibitors of the protein tyrosine phosphatase CD45., 44 (11): [PMID:11356112 ] [10.1021/jm000447i ]