(3S,7S,10R,11S,12S,17R)-7,11-Dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-methyl-2-((S)-2-methylsulfanyl-thiazol-4-yl)-vinyl]-4,17-dioxa-bicyclo[14.1.0]heptadecane-5,9-dione

ID: ALA2373360

Cas Number: 252981-48-9

PubChem CID: 9871979

Max Phase: Preclinical

Molecular Formula: C27H41NO6S2

Molecular Weight: 539.76

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CSc1nc(/C=C(\C)[C@@H]2C[C@@H]3O[C@]3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1

Standard InChI:  InChI=1S/C27H41NO6S2/c1-15-9-8-10-27(6)21(34-27)12-19(16(2)11-18-14-36-25(28-18)35-7)33-22(30)13-20(29)26(4,5)24(32)17(3)23(15)31/h11,14-15,17,19-21,23,29,31H,8-10,12-13H2,1-7H3/b16-11+/t15-,17+,19-,20-,21?,23-,27+/m0/s1

Standard InChI Key:  FODFUEDBIXOGNY-PYOUCAHOSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
    1.5167    1.4958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042    1.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3333   -1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208   -1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0375   -1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -0.3625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6167    0.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3750   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2292   -1.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2292   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0917   -1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042   -1.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0917    0.9708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6625   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0375   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3292    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3333   -2.6250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -2.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4417    0.3833    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3333   -0.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0917    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7583   -0.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0917   -2.6250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0333   -0.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083   -0.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8375   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208    1.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3333    0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667    0.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167    0.6708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  6  1  0
  5 13  1  0
  6 19  1  0
  7 10  1  0
  8  7  2  0
  9 11  1  0
 10 17  1  0
 11 12  1  0
 12 14  1  0
 13 15  1  0
 14  3  1  0
 15  9  1  0
 16 20  1  0
 17 18  2  0
 12 18  1  1
 19 24  1  0
 20 10  2  0
 21  4  2  0
 22  9  2  0
 23  8  1  0
 24 34  1  0
 25  2  1  0
 19 26  1  1
 13 27  1  6
  2 28  1  6
  5 29  1  0
  5 30  1  0
  6 31  1  6
 32 18  1  0
 33 25  1  0
 34 33  1  0
 24 35  1  6
 36 23  1  0
  3  2  1  0
  8 16  1  0
  4  5  1  0
  3 37  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA2373360

   4,17-Dioxabicyclo(14.1.0)heptadecane-5,9-dione, 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-((1E)-1-methyl-2-(2-(methylthio)-4-thiazolyl)ethenyl)-, (1S,3S,7S,10R,11S,12S,16R)-

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 539.76

Molecular Weight (Monoisotopic): 539.2375

AlogP: 4.89

#Rotatable Bonds: 3

Polar Surface Area: 109.25

Molecular Species: NEUTRAL

HBA: 9

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: 0.85

CX LogP: 5.31

CX LogD: 5.31

Aromatic Rings: 1

Heavy Atoms: 36

QED Weighted: 0.32

Np Likeness Score: 1.97

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source

Source(1):

• Scientific Literature