(3S,7S,10R,11S,12S,17S)-7,11-Dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-methyl-2-((S)-5-methyl-pyridin-2-yl)-vinyl]-4-oxa-bicyclo[14.1.0]heptadecane-5,9-dione

ID: ALA2373567

PubChem CID: 6918681

Max Phase: Preclinical

Molecular Formula: C29H43NO5

Molecular Weight: 485.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\c1ccc(C)cn1)[C@@H]1C[C@@H]2C[C@H]2CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1

Standard InChI:  InChI=1S/C29H43NO5/c1-17-10-11-23(30-16-17)12-19(3)24-14-22-13-21(22)9-7-8-18(2)27(33)20(4)28(34)29(5,6)25(31)15-26(32)35-24/h10-12,16,18,20-22,24-25,27,31,33H,7-9,13-15H2,1-6H3/b19-12+/t18-,20+,21?,22-,24-,25-,27-/m0/s1

Standard InChI Key:  MHRYIUJPPVFCBJ-DWGSAIITSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
   -1.0500   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7583   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000    0.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875    0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -2.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875   -2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2250   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7583   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9417   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625   -1.5542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -3.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -3.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0500   -1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0792   -1.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4750   -1.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -3.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2417   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9250   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0792   -0.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5583   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -0.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625    0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2250   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375    0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -0.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375   -1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7917    0.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875    0.0958    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8000   -0.3117    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  7  1  0
  7  5  1  0
  6 11  1  0
  7 29  1  0
  8  6  1  0
  9  2  1  0
 10  8  1  0
 11  9  1  0
 10 12  1  1
 13  3  1  0
 14 12  2  0
 15 10  1  0
 16 18  2  0
 17  1  2  0
 18 14  1  0
 19  6  2  0
 20 13  1  0
 21 16  1  0
 13 22  1  1
  9 23  1  6
  2 24  1  0
  2 25  1  0
 26 30  1  0
  3 27  1  6
 28 18  1  0
 29 32  1  0
 30 28  2  0
 31 12  1  0
 32 33  1  0
 33 20  1  0
 20 34  1  6
 35 26  1  0
 15  4  1  0
  4  5  1  0
 21 26  2  0
  7 36  1  6
  4 37  1  6
M  END

Associated Targets(Human)

1A9 (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-10 (150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-22 (54 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.67Molecular Weight (Monoisotopic): 485.3141AlogP: 4.89#Rotatable Bonds: 2
Polar Surface Area: 96.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.05CX LogP: 5.39CX LogD: 5.39
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.58Np Likeness Score: 1.68

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]
2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source